CAS 205748-06-7

3-(2,4,5-Trimethylphenyl)-2-propenoic acid

Description:

3-(2,4,5-Trimethylphenyl)-2-propenoic acid, also known as a derivative of cinnamic acid, is an organic compound characterized by its propenoic acid structure with a substituted aromatic ring. This compound features a phenyl group with three methyl groups at the 2, 4, and 5 positions, contributing to its hydrophobic characteristics and potential for various chemical interactions. It typically appears as a solid or liquid at room temperature, depending on its specific formulation and purity. The presence of the propenoic acid moiety suggests that it can participate in various chemical reactions, including polymerization and esterification. Its unique structure may impart specific biological activities, making it of interest in fields such as pharmaceuticals and materials science. Additionally, the compound's solubility and reactivity can be influenced by the presence of the trimethylphenyl group, which may affect its applications in synthesis and as a potential intermediate in organic reactions. Safety and handling precautions should be observed, as with many organic compounds, to mitigate any risks associated with exposure.

Formula: C₁₂H₁₄O₂

InChI: InChI=1S/C12H14O2/c1-8-6-10(3)11(7-9(8)2)4-5-12(13)14/h4-7H,1-3H3,(H,13,14)

InChI key: InChIKey=OUSXTDXBZCOQIT-UHFFFAOYSA-N

SMILES: C(=CC(O)=O)C1=C(C)C=C(C)C(C)=C1

Synonyms:

• 2-Propenoic acid, 3-(2,4,5-trimethylphenyl)-
• 3-(2,4,5-Trimethylphenyl)-2-propenoic acid

2,4,5-Trimethylcinnamic acid

CAS: 205748-06-7

2,4,5-Trimethylcinnamic acid is a useful scaffold for the synthesis of complex compounds. It is also used as a reagent and reaction component in organic synthesis. This chemical has a CAS number of 205748-06-7 and is classified as a speciality chemical.

Formula: C₁₂H₁₄O₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 190.24 g/mol

Ref: 3D-FT70166