CAS 205750-82-9

ethyl 2-fluoro-4-iodobenzoate

Description:

Ethyl 2-fluoro-4-iodobenzoate is an organic compound characterized by its ester functional group, specifically an ethyl ester of benzoic acid, with a fluorine atom and an iodine atom substituted on the aromatic ring. This compound features a benzene ring with the ethyl ester group attached to the carboxylic acid, along with the halogen substituents at the 2 and 4 positions, respectively. The presence of both fluorine and iodine introduces unique reactivity and properties, such as potential for nucleophilic substitution reactions and varying solubility in organic solvents. Ethyl 2-fluoro-4-iodobenzoate is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as an intermediate in various chemical reactions. Its molecular structure contributes to its physical properties, including boiling and melting points, which are influenced by the size and electronegativity of the halogen substituents. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.

Formula: C₉H₈FIO₂

InChI: InChI=1/C9H8FIO2/c1-2-13-9(12)7-4-3-6(11)5-8(7)10/h3-5H,2H2,1H3

SMILES: CCOC(=O)c1ccc(cc1F)I

Synonyms:

• Benzoic acid, 2-fluoro-4-iodo-, ethyl ester

Benzoic acid, 2-fluoro-4-iodo-, ethyl ester

CAS: 205750-82-9

Formula: C₉H₈FIO₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 294.0615

Ref: IN-DA002ABZ

Ethyl 2-fluoro-4-iodobenzoate

CAS: 205750-82-9

Ethyl 2-fluoro-4-iodobenzoate

Purity: 97%

Molecular weight: 294.06g/mol

Ref: 54-PC99516

Ethyl 2-fluoro-4-iodobenzoate

CAS: 205750-82-9

Formula: C₉H₈FIO₂

Purity: 97%

Color and Shape: Liquid, Clear

Molecular weight: 294.064

Ref: 10-F037786