CymitQuimica logo

CAS 20576-82-3

:

4-(tert-butoxycarbonyl)benzoic acid

Description:
4-(tert-Butoxycarbonyl)benzoic acid, with the CAS number 20576-82-3, is an organic compound characterized by its benzoic acid structure modified with a tert-butoxycarbonyl (Boc) protecting group. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as dichloromethane and ethyl acetate, but has limited solubility in water. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The Boc group serves as a protective group for amines, making this compound useful in organic synthesis, particularly in peptide chemistry. Its stability under basic conditions and reactivity under acidic conditions make it a versatile intermediate in the synthesis of more complex molecules. Additionally, 4-(tert-butoxycarbonyl)benzoic acid can be utilized in the development of pharmaceuticals and agrochemicals, highlighting its significance in both medicinal and industrial chemistry.
Formula:C12H14O4
InChI:InChI=1/C12H14O4/c1-12(2,3)16-11(15)9-6-4-8(5-7-9)10(13)14/h4-7H,1-3H3,(H,13,14)
InChI key:ILBDCOLCHNVWNS-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)c1ccc(cc1)C(=O)O
Synonyms:
  • 1,4-Benzenedicarboxylic acid, mono(1,1-dimethylethyl) ester
  • 4-(tert-Butoxycarbonyl)benzoic acid
Found 5 products.