CAS 20577-12-2
:1-hydroxy-1,3-diphenylthiourea
Description:
1-Hydroxy-1,3-diphenylthiourea is an organic compound characterized by its thiourea functional group, which features a sulfur atom bonded to a carbon atom that is also double-bonded to an oxygen atom and single-bonded to an amine group. This compound typically appears as a white to off-white crystalline solid. It is known for its role as a reagent in various chemical reactions, particularly in the synthesis of other organic compounds. The presence of two phenyl groups contributes to its stability and influences its solubility properties, making it more soluble in organic solvents than in water. Additionally, 1-hydroxy-1,3-diphenylthiourea exhibits potential biological activity, which has been explored in various studies. Its chemical structure allows for hydrogen bonding, which can affect its reactivity and interactions with other molecules. As with many thiourea derivatives, it is important to handle this compound with care due to potential toxicity and environmental considerations.
Formula:C13H12N2OS
InChI:InChI=1/C13H12N2OS/c16-15(12-9-5-2-6-10-12)13(17)14-11-7-3-1-4-8-11/h1-10,16H,(H,14,17)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
