CAS 2058-72-2: 5-Bromo-1-methylisatin
Description:5-Bromo-1-methylisatin is an organic compound characterized by its unique structure, which includes a bromine atom and a methyl group attached to an isatin core. Isatin itself is a diketone derived from indole, and the presence of the bromine substituent at the 5-position enhances its reactivity and potential applications in various chemical reactions. This compound typically appears as a solid and is known for its potential biological activities, including antimicrobial and anticancer properties. Its molecular formula reflects the presence of carbon, hydrogen, nitrogen, and bromine, contributing to its diverse chemical behavior. 5-Bromo-1-methylisatin can participate in various reactions, such as nucleophilic substitutions and cyclization processes, making it a valuable intermediate in organic synthesis. Additionally, its derivatives are often explored in medicinal chemistry for their pharmacological potential. As with many halogenated compounds, safety precautions should be taken when handling 5-Bromo-1-methylisatin due to its potential toxicity and environmental impact.
Formula:C9H6BrNO2
InChI:InChI=1S/C9H6BrNO2/c1-11-7-3-2-5(10)4-6(7)8(12)9(11)13/h2-4H,1H3
InChI key:InChIKey=GEEDYJPPYNIZLX-UHFFFAOYSA-N
SMILES:O=C1C(=O)N(C2=CC=C(Br)C=C12)C
- Synonyms:
- 1-Methyl-5-bromoisatin
- 1H-indole-2,3-dione, 5-bromo-1-methyl-
- 5-Bromo-1-methylindole-2,3-dione
- 5-Bromo-1-methylindoline-2,3-dione
- 5-Bromo-1-methylisatin
- 5-Bromo-N-methylisatin
- Indole-2,3-dione, 5-bromo-1-methyl-
- Isatin, 5-bromo-1-methyl-
- 5-Bromo-1-methyl-1H-indole-2,3-dione

5-Bromo-1-methylisatin
Ref: 3B-B4779
1g | 85.00 € | ||
5g | 272.00 € |

1H-Indole-2,3-dione, 5-bromo-1-methyl-
Ref: IN-DA002ADI
1g | 47.00 € | ||
5g | 84.00 € | ||
25g | 232.00 € | ||
100mg | 22.00 € | ||
250mg | 26.00 € |

Ref: 54-OR90159
1g | 36.00 € | ||
5g | 83.00 € | ||
25g | 342.00 € | ||
100g | 1,194.00 € | ||
250mg | 32.00 € |

5-bromo-1-methyl-1H-indole-2,3-dione
Ref: 10-F311029
1g | 25.00 € | ||
5g | 65.00 € | ||
10g | 118.00 € | ||
25g | 270.00 € |

5-Bromo-1-methyl-1H-indole-2,3-dione
Ref: 3D-FB131179
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |