CAS 2058-89-1
:1,1-Bis(4-pyridine aldoxime)methane dibromide
Description:
1,1-Bis(4-pyridine aldoxime)methane dibromide, with the CAS number 2058-89-1, is a chemical compound that features a central carbon atom bonded to two 4-pyridine aldoxime groups and two bromine atoms. This compound is characterized by its dual functionality, combining the properties of pyridine and aldoxime, which can facilitate coordination with metal ions and exhibit reactivity towards electrophiles. It is typically used in the field of chemistry for its potential applications in coordination chemistry and as a reagent in organic synthesis. The presence of bromine atoms enhances its reactivity, making it useful in various chemical transformations. Additionally, the pyridine rings contribute to its solubility in polar solvents and its ability to engage in hydrogen bonding. Overall, this compound is of interest in research areas such as medicinal chemistry and materials science, where its unique structural features can be exploited for developing new materials or therapeutic agents.
Formula:C13H14N4O2·2Br
InChI:InChI=1S/C13H12N4O2.2BrH/c18-14-9-12-1-5-16(6-2-12)11-17-7-3-13(4-8-17)10-15-19;;/h1-10H,11H2;2*1H
InChI key:InChIKey=ZKQNRRLCBJUEBC-UHFFFAOYSA-N
SMILES:C([N+]=1C=CC(C=NO)=CC1)[N+]=2C=CC(C=NO)=CC2.[Br-]
Synonyms:- 1,1-Bis(4-pyridine aldoxime)methane dibromide
- Pyridinium, 1,1′-methylenebis[4-[(hydroxyimino)methyl]-, bromide (1:2)
- Pyridinium, 1,1′-methylenebis[4-[(hydroxyimino)methyl]-, dibromide
- Pyridinium, 1,1′-methylenebis[4-formyl-, dibromide, dioxime
- 1,1′-Methylenebis[4-formylpyridinium bromide], dioxime
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
MMB-4
CAS:MMB-4 is an oxime drug that is used as an anthelmintic. It has a low potency and body formation, which is thought to be due to its pyridinium group. MMB-4 has been shown to have both anthelmintic and antihelminthic effects in mice, as well as being effective against a number of parasites in vitro. MMB-4 has also been shown to have no effect on the human serum at physiological levels, but can cause serious side effects when taken at higher concentrations. The cyclic peptide MMB-4 was synthesized by chemical methods from indirubin, which is a natural product found in plants. In the study, it was shown that the reaction mechanism for MMB-4 involves the formation of a free radical intermediate with oxygen. This intermediate then reacts with other molecules to form covalent bonds. MMB-4 can be used for analytical purposes due to its stability and reactFormula:C13H14Br2N4O2Purity:Min. 95%Molecular weight:418.08 g/molMMB-4
CAS:MMB-4 is an oxime that can reactivate cholinesterases (cholinesterases) which have been inactivated due to exposure to organophosphates such as Sarin or Soman.Formula:C13H14Br2N4O2Color and Shape:SolidMolecular weight:418.084

