CAS 20581-41-3: B-D-glucopyranosylphenyl isothiocyanate

Description:B-D-glucopyranosylphenyl isothiocyanate is a chemical compound characterized by its isothiocyanate functional group, which is known for its potential biological activity, particularly in the context of cancer research and as a bioactive compound in various plant extracts. This compound features a glucopyranosyl moiety, which is a glucose derivative, linked to a phenyl group and an isothiocyanate group. The presence of the isothiocyanate group suggests that it may exhibit properties such as antimicrobial, antifungal, and anticancer activities, as many isothiocyanates are derived from cruciferous vegetables and are studied for their health benefits. The glucopyranosyl component may enhance solubility and bioavailability, making it an interesting subject for pharmacological studies. Additionally, the compound's structure allows for potential interactions with biological macromolecules, which could lead to various physiological effects. Overall, B-D-glucopyranosylphenyl isothiocyanate represents a unique combination of carbohydrate and isothiocyanate chemistry, warranting further investigation into its applications in health and disease.

Formula:C₁₃H₁₅NO₅S

InChI:InChI=1/C13H15NO5S/c15-5-9-10(16)11(17)12(18)13(19-9)7-3-1-2-4-8(7)14-6-20/h1-4,9-13,15-18H,5H2/t9-,10-,11+,12-,13+/m1/s1

Synonyms:
p-Isothiocyanatophenyl -D-Glucopyranoside
4-Isothiocyanatophenyl Hexopyranoside

Found 3 products.

Product data	Purity	Price range	Estimated delivery
β-D-Glucopyranosylphenyl isothiocyanate REF: 7W-GC8534CAS: 20581-41-3	- - -	To inquire	Tue 06 May 25
4-Isothiocyanatophenyl b-D-Glucopyranoside >80% REF: TR-I905120CAS: 20581-41-3	>80%	119.00 €~186.00 €	Tue 13 May 25
4-Isothiocyanatophenyl-b-D-glucopyranoside REF: 3D-MI04769CAS: 20581-41-3	Min. 95%	To inquire	Mon 16 Jun 25