CAS 20581-41-3
:B-D-glucopyranosylphenyl isothiocyanate
Description:
B-D-glucopyranosylphenyl isothiocyanate is a chemical compound characterized by its isothiocyanate functional group, which is known for its potential biological activity, particularly in the context of cancer research and as a bioactive compound in various plant extracts. This compound features a glucopyranosyl moiety, which is a glucose derivative, linked to a phenyl group and an isothiocyanate group. The presence of the isothiocyanate group suggests that it may exhibit properties such as antimicrobial, antifungal, and anticancer activities, as many isothiocyanates are derived from cruciferous vegetables and are studied for their health benefits. The glucopyranosyl component may enhance solubility and bioavailability, making it an interesting subject for pharmacological studies. Additionally, the compound's structure allows for potential interactions with biological macromolecules, which could lead to various physiological effects. Overall, B-D-glucopyranosylphenyl isothiocyanate represents a unique combination of carbohydrate and isothiocyanate chemistry, warranting further investigation into its applications in health and disease.
Formula:C13H15NO5S
InChI:InChI=1/C13H15NO5S/c15-5-9-10(16)11(17)12(18)13(19-9)7-3-1-2-4-8(7)14-6-20/h1-4,9-13,15-18H,5H2/t9-,10-,11+,12-,13+/m1/s1
Synonyms:- p-Isothiocyanatophenyl -D-Glucopyranoside
- 4-Isothiocyanatophenyl Hexopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Isothiocyanatophenyl b-D-Glucopyranoside >80%
CAS:Controlled Product<p>Stability Hygroscopic<br>Applications A useful substrate for the preparation of neoglycoproteins.<br>References Monsigny, M., et al.: Biol. Cell, 51, 187 (1984)<br></p>Formula:C13H15NO6SPurity:>80%Color and Shape:Off-WhiteMolecular weight:313.334-Isothiocyanatophenyl-b-D-glucopyranoside
CAS:<p>4-Isothiocyanatophenyl-b-D-glucopyranoside is an electrophilic compound that can be used as a reagent in organic synthesis. It reacts with nucleophiles and is used for nitro reduction, sulfoxide formation, and phenoxy formation. The structure of the molecule is characterized by two chiral centers. The reactivity of this molecule depends on the orientation of the substituents on the two chiral centers. 4-Isothiocyanatophenyl-b-D-glucopyranoside can also be used to form esters. The ethoxycarbonyl group (C=O) on one end of the molecule reacts with carboxylic acids to form esters, while at the other end of the molecule, hydroxy groups (OH) react with alcohols to form ethers.</p>Formula:C13H15NO6SPurity:Min. 95%Molecular weight:313.33 g/mol


