CAS 205865-67-4
:Acetic acid, difluoro(trimethylsilyl)-, ethyl ester
Description:
Acetic acid, difluoro(trimethylsilyl)-, ethyl ester, with the CAS number 205865-67-4, is an organofluorine compound characterized by the presence of both acetic acid and a difluorinated trimethylsilyl group. This compound typically exhibits properties associated with esters, such as volatility and solubility in organic solvents. The presence of the difluoromethyl group can enhance its reactivity and influence its physical properties, including boiling point and polarity. The trimethylsilyl group contributes to the compound's stability and can affect its behavior in various chemical reactions, particularly in nucleophilic substitutions and as a protecting group in organic synthesis. Additionally, the ethyl ester moiety suggests that it may participate in esterification and hydrolysis reactions. Overall, this compound is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or agrochemicals due to its unique structural features. Safety data should be consulted for handling and storage, as with all chemical substances.
InChI:InChI=1S/C7H14F2O2Si/c1-5-11-6(10)7(8,9)12(2,3)4/h5H2,1-4H3
SMILES:CCOC(=O)C(F)(F)[Si](C)(C)C
Synonyms:- Ethyl difluoro(trimethylsilyl)acetate
- Ethyl�trimethylsilyldifluoroacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethyl 2,2-Difluoro-2-(trimethylsilyl)acetate
CAS:Formula:C7H14F2O2SiPurity:>97.0%(GC)Color and Shape:Colorless to Light yellow clear liquid to cloudy liquidMolecular weight:196.27Ethyl difluoro(trimethylsilyl)acetate
CAS:Ethyl difluoro(trimethylsilyl)acetateFormula:C7H14F2O2SiPurity:95%Color and Shape: clear. colourless liquidMolecular weight:196.27g/molEthyl trimethylsilyldifluoroacetate
CAS:Formula:C7H14F2O2SiPurity:95.0%Color and Shape:LiquidMolecular weight:196.269Ethyl 2,2-difluoro-2-(trimethylsilanyl)acetate
CAS:Formula:C7H14F2O2SiPurity:98%Color and Shape:LiquidMolecular weight:196.2672



