CAS 205873-55-8

5-[2-(4-Bromophenyl)ethenyl]-1,3-benzenediol

Description:

5-[2-(4-Bromophenyl)ethenyl]-1,3-benzenediol, with the CAS number 205873-55-8, is an organic compound characterized by its complex aromatic structure. It features a central 1,3-benzenediol moiety, which is a dihydroxy-substituted benzene, providing it with potential antioxidant properties. The presence of a 4-bromophenyl group attached via an ethenyl linkage introduces significant hydrophobic characteristics and may influence its reactivity and biological activity. This compound is likely to exhibit moderate solubility in organic solvents while being less soluble in water due to its hydrophobic nature. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of compounds with anti-cancer or anti-inflammatory properties. Additionally, the bromine substituent may enhance its reactivity in electrophilic substitution reactions. Overall, the unique combination of functional groups and aromatic systems in this compound contributes to its potential utility in various chemical and biological applications.

Formula: C₁₄H₁₁BrO₂

InChI: InChI=1S/C14H11BrO2/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11/h1-9,16-17H

InChI key: InChIKey=NCJVLKFAQIWASE-UHFFFAOYSA-N

SMILES: C(=CC1=CC=C(Br)C=C1)C2=CC(O)=CC(O)=C2

Synonyms:

• 5-[2-(4-Bromophenyl)ethenyl]-1,3-benzenediol
• 1,3-Benzenediol, 5-[2-(4-bromophenyl)ethenyl]-

1,3-Benzenediol, 5-[2-(4-bromophenyl)ethenyl]-

CAS: 205873-55-8

Formula: C₁₄H₁₁BrO₂

Molecular weight: 291.1399

Ref: IN-DA002ADY

3,5-Dihydroxy-4'-bromostilbene

CAS: 205873-55-8

3,5-Dihydroxy-4'-bromostilbene is a reagent and useful intermediate. It is a complex compound that can be used to make speciality chemicals. 3,5-Dihydroxy-4'-bromostilbene is also a useful scaffold and building block for making new compounds. This compound is used in research and development as a versatile building block for the synthesis of new compounds with high quality.

Formula: C₁₄H₁₁BrO₂

Purity: Min. 95%

Molecular weight: 291.14 g/mol

Ref: 3D-FD66672