CAS 205873-57-0
:3-Bromo-2-methoxybenzenemethanol
Description:
3-Bromo-2-methoxybenzenemethanol, with the CAS number 205873-57-0, is an organic compound characterized by its aromatic structure, which includes a bromine atom and a methoxy group attached to a benzene ring. This compound features a hydroxymethyl group (-CH2OH) that contributes to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic properties, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions. The methoxy group can influence the compound's solubility and reactivity, often making it more lipophilic. In terms of physical properties, it is typically a solid at room temperature, with specific melting and boiling points that depend on its purity and crystalline form. The compound may exhibit moderate toxicity, and safety precautions should be taken when handling it in a laboratory setting. Overall, 3-Bromo-2-methoxybenzenemethanol is of interest in medicinal chemistry and materials science due to its functional groups and potential for further chemical modification.
Formula:C8H9BrO2
InChI:InChI=1S/C8H9BrO2/c1-11-8-6(5-10)3-2-4-7(8)9/h2-4,10H,5H2,1H3
InChI key:InChIKey=VUMYHCICIPHSKN-UHFFFAOYSA-N
SMILES:C(O)C1=C(OC)C(Br)=CC=C1
Synonyms:- Benzenemethanol, 3-bromo-2-methoxy-
- (3-Bromo-2-methoxyphenyl)methanol
- 3-Bromo-2-methoxybenzenemethanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzenemethanol, 3-bromo-2-methoxy-
CAS:Formula:C8H9BrO2Purity:95%Color and Shape:SolidMolecular weight:217.05993-Bromo-2-methoxybenzyl alcohol
CAS:3-Bromo-2-methoxybenzyl alcoholPurity:≥95%Molecular weight:217.06g/mol3-Bromo-2-methoxybenzyl alcohol
CAS:3-Bromo-2-methoxybenzyl alcohol is a reaction component that is used in the synthesis of a number of chemical compounds. It has been shown to be a useful scaffold, with versatile building blocks and intermediates. 3-Bromo-2-methoxybenzyl alcohol is an intermediate for the synthesis of complex compounds such as antihypertensive drugs, anti-inflammatory agents, and immunosuppressant drugs. This compound also has a variety of uses in research including as a reagent for the determination of enzyme activity and as an analytical reference standard.Formula:C8H9BrO2Purity:Min. 95%Color and Shape:PowderMolecular weight:217.06 g/mol



