CAS 205873-58-1
:Ethyl 1H-indole-7-carboxylate
Description:
Ethyl 1H-indole-7-carboxylate is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features an ethyl ester functional group at the carboxylic acid position, specifically at the 7th position of the indole ring. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. Ethyl 1H-indole-7-carboxylate is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The compound may exhibit various biological activities, including anti-inflammatory and antimicrobial properties, making it of interest in drug discovery. Additionally, it is soluble in organic solvents, which facilitates its use in various chemical reactions and syntheses. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C11H11NO2
InChI:InChI=1S/C11H11NO2/c1-2-14-11(13)9-5-3-4-8-6-7-12-10(8)9/h3-7,12H,2H2,1H3
InChI key:InChIKey=WZXGOHXFXHUJLR-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C2C(=CC=C1)C=CN2
Synonyms:- 1H-Indole-7-carboxylic acid ethyl ester
- Ethyl indole-7-carboxylate
- ethyl 1H-indole-7-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Indole-7-carboxylic acid, ethyl ester
CAS:Formula:C11H11NO2Purity:98%Color and Shape:SolidMolecular weight:189.2105Indole-7-carboxylic acid ethyl ester
CAS:Indole-7-carboxylic acid ethyl esterPurity:95%Molecular weight:189.21g/molEthyl indole-7-carboxylate
CAS:Ethyl indole-7-carboxylate is a fine chemical that is used as a versatile building block for the synthesis of complex compounds. It can act as a research chemical, reagent, or specialty chemical. This compound has been used to prepare various useful intermediates and reaction components, such as 4-chloro-3-nitrobenzaldehyde and 3-(2,6-dimethoxyphenyl)acrylonitrile. The CAS number for ethyl indole-7-carboxylate is 205873-58-1.
Purity:Min. 95%Ref: 3D-FE43779
Discontinued product



