CAS 205877-26-5

4-ethynyl-N,N-diphenylaniline

Description:

4-Ethynyl-N,N-diphenylaniline, identified by its CAS number 205877-26-5, is an organic compound characterized by its structure, which includes an ethynyl group and two phenyl groups attached to a nitrogen atom. This compound is typically classified as an arylamine due to the presence of the aniline moiety. It exhibits properties such as being a solid at room temperature, with potential applications in organic electronics, particularly in the development of organic light-emitting diodes (OLEDs) and other optoelectronic devices. The ethynyl group contributes to its reactivity, allowing for further functionalization and polymerization. Additionally, the presence of multiple phenyl groups enhances its stability and may influence its electronic properties, making it a subject of interest in materials science. Safety data should be consulted, as with many organic compounds, to understand its handling and potential hazards. Overall, 4-ethynyl-N,N-diphenylaniline represents a versatile compound in the field of organic chemistry and materials engineering.

Formula: C₂₀H₁₅N

InChI: InChI=1/C20H15N/c1-2-17-13-15-20(16-14-17)21(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h1,3-16H

SMILES: C#Cc1ccc(cc1)N(c1ccccc1)c1ccccc1

Synonyms:

• (4-Ethynyl-phenyl)-diphenyl-amine
• benzenamine, 4-ethynyl-N,N-diphenyl-

4-Ethynyltriphenylamine

CAS: 205877-26-5

Formula: C₂₀H₁₅N

Purity: >98.0%(HPLC)(N)

Color and Shape: Light orange to Yellow to Green powder to crystal

Molecular weight: 269.35

Ref: 3B-E0894

Benzenamine, 4-ethynyl-N,N-diphenyl-

CAS: 205877-26-5

Formula: C₂₀H₁₅N

Purity: 95%

Color and Shape: Solid

Molecular weight: 269.3398

Ref: IN-DA002ADS

4-Ethynyl-N,N-diphenylaniline

CAS: 205877-26-5

4-Ethynyl-N,N-diphenylaniline

Purity: 98%

Molecular weight: 269.34g/mol

Ref: 54-OR90657

4-ETHYNYL-N,N-DIPHENYLANILINE

CAS: 205877-26-5

Formula: C₂₀H₁₅N

Purity: 95%

Color and Shape: Solid

Molecular weight: 269.347

Ref: 10-F532801