CAS 20590-32-3
:Mead acid
Description:
Mead acid, scientifically known as 5,8,11-eicosatrienoic acid, is a polyunsaturated fatty acid characterized by its unique structure featuring three double bonds in the eicosa (20-carbon) chain. It is primarily found in certain animal tissues, particularly in the liver and brain, and is notable for its role in the metabolism of essential fatty acids. Mead acid is considered an important biomarker for dietary deficiencies, particularly in essential fatty acids like linoleic acid. Its presence can indicate the body's adaptation to low levels of these essential fats. The acid is also studied for its potential anti-inflammatory properties and its role in various physiological processes. In terms of solubility, Mead acid is generally soluble in organic solvents but less so in water, typical of fatty acids. Its molecular structure contributes to its reactivity and interactions with other biological molecules, making it a subject of interest in nutritional and biomedical research.
Formula:C20H34O2
InChI:InChI=1S/C20H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h9-10,12-13,15-16H,2-8,11,14,17-19H2,1H3,(H,21,22)/b10-9-,13-12-,16-15-
InChI key:InChIKey=UNSRRHDPHVZAHH-YOILPLPUSA-N
SMILES:C(=C\C/C=C\CCCCCCCC)\C/C=C\CCCC(O)=O
Synonyms:- (5Z,8Z,11Z)-5,8,11-Eicosatrienoic acid
- (5Z,8Z,11Z)-icosa-5,8,11-trienoic acid
- (Z,Z,Z)-5,8,11-Eicosatrienoic acid
- 5,8,11-Eicosatrienoic acid
- 5,8,11-Eicosatrienoic acid, (5Z,8Z,11Z)-
- 5,8,11-Eicosatrienoic acid, (Z,Z,Z)-
- 5Z,8Z,11Z-Eicosatrienoic acid
- Icosa-5,8,11-Trienoic Acid
- Mead acid
- all-cis-5,8,11-Eicosatrienoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Mead acid
CAS:Mead acid, a 5,8,11-Eicosatrienoic Omega-9 unsaturated fatty acid, signals essential fatty acid deficiency.Formula:C20H34O2Color and Shape:SolidMolecular weight:306.495(Z),8(Z),11(Z)-Eicosatrienoic acid
CAS:Formula:C20H34O2Purity:>98%Color and Shape:LiquidMolecular weight:306.48(5Z,8Z,11Z)-5,8,11-Eicosatrienoic acid
CAS:(5Z,8Z,11Z)-5,8,11-Icosatrienoic acid is a fatty acid that has anti-angiogenic effects. This compound is synthesized from arachidonic acid by the enzyme delta-5-desaturase and inhibits the formation of new blood vessels by promoting the death of endothelial cells. The synthesis of (5Z,8Z,11Z)-5,8,11-Icosatrienoic acid in liver cells is stimulated by an increase in body mass index and a decrease in fatty acids. This molecule has been shown to have physiological effects on brain function and to have anti-inflammatory properties. It also binds to the CB2 receptor.Formula:C20H34O2Purity:Min. 95%Molecular weight:306.48 g/molMead Acid (20:3, n-9)
CAS:Controlled ProductFormula:C20H34O2Color and Shape:NeatMolecular weight:306.483





