CymitQuimica logo

CAS 205926-99-4

:

2,2',3,3',5,5',6,6'-octafluorobiphenyl-4,4'-diol hydrate (1:1)

Description:
2,2',3,3',5,5',6,6'-octafluorobiphenyl-4,4'-diol hydrate (1:1), with the CAS number 205926-99-4, is a fluorinated organic compound characterized by its biphenyl structure, where eight hydrogen atoms are replaced by fluorine atoms, resulting in enhanced chemical stability and unique electronic properties. The presence of hydroxyl (-OH) groups on the biphenyl framework contributes to its potential solubility in polar solvents and may influence its reactivity and interaction with other chemical species. As a hydrate, it contains water molecules in its crystalline structure, which can affect its physical properties, such as melting point and solubility. This compound is of interest in various fields, including materials science and organic electronics, due to its potential applications in developing advanced materials with specific electronic or optical properties. Its fluorinated nature may also impart hydrophobic characteristics, making it suitable for applications requiring chemical resistance. Safety and handling precautions should be observed, as with all fluorinated compounds, due to potential toxicity and environmental impact.
Formula:C12H4F8O3
InChI:InChI=1/C12H2F8O2.H2O/c13-3-1(4(14)8(18)11(21)7(3)17)2-5(15)9(19)12(22)10(20)6(2)16;/h21-22H;1H2
SMILES:c1(c2c(c(c(c(c2F)F)O)F)F)c(c(c(c(c1F)F)O)F)F.O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.