CAS 20595-30-6
:(2E)-3-(3-Fluorophenyl)-2-propenoic acid
Description:
(2E)-3-(3-Fluorophenyl)-2-propenoic acid, also known as a derivative of cinnamic acid, is an organic compound characterized by its propenoic acid structure with a fluorophenyl substituent. This compound features a double bond between the second and third carbon atoms, which contributes to its reactivity and potential applications in organic synthesis. The presence of the fluorine atom on the phenyl ring can influence the compound's electronic properties, making it of interest in medicinal chemistry and materials science. Typically, such compounds exhibit moderate solubility in organic solvents and may have varying degrees of acidity due to the carboxylic acid functional group. The geometric configuration (E) indicates that the substituents on the double bond are on opposite sides, which can affect the compound's physical and chemical properties, including its stability and reactivity. Overall, (2E)-3-(3-Fluorophenyl)-2-propenoic acid is a valuable compound for research and development in various chemical applications.
Formula:C9H7FO2
InChI:InChI=1S/C9H7FO2/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-6H,(H,11,12)/b5-4+
InChI key:InChIKey=RTSIUKMGSDOSTI-SNAWJCMRSA-N
SMILES:C(=C/C(O)=O)\C1=CC(F)=CC=C1
Synonyms:- (2E)-3-(3-Fluorophenyl)-2-propenoic acid
- (2E)-3-(3-fluorophenyl)acrylic acid
- (2E)-3-(3-fluorophenyl)prop-2-enoate
- (2E)-3-(3-fluorophenyl)prop-2-enoic acid
- (3-Fluoropyridin-4-Yl)Boronic Acid
- (E)-3-(3-Fluorophenyl)acrylic acid
- (E)-3-Fluorocinnamic acid
- (E)-m-fluorocinnamic acid
- 2-Propenoic acid, 3-(3-fluorophenyl)-, (2E)-
- 2-Propenoic acid, 3-(3-fluorophenyl)-, (E)-
- Cinnamic acid, m-fluoro-, (E)-
- Trans-3-Fluorocinnamic acid
- m-Fluorocinnamic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
trans-3-Fluorocinnamic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H7FO2Purity:98%Color and Shape:Crystals or powder or crystalline powder, WhiteMolecular weight:166.152-Propenoic acid, 3-(3-fluorophenyl)-, (2E)-
CAS:Formula:C9H7FO2Purity:95%Color and Shape:SolidMolecular weight:166.14913-Fluorocinnamic acid
CAS:3-Fluorocinnamic acid is an organic compound that belongs to the class of amides. It reacts with metal ions such as copper, silver, or gold. 3-Fluorocinnamic acid has a constant boiling point and can be used in the preparation of cinnamic acid derivatives. 3-Fluorocinnamic acid also has redox potential and is used as a substrate in enzyme preparations. 3-Fluorocinnamic acid can be synthesized by hydrolysis of malonic acid and metal salts with hydrochloric acid, which then reacts with triticum aestivum. The product is purified by recrystallization from water. This compound inhibits the reaction that converts lactose into glucose and galactose, leading to the production of lactic acid from milk.
Formula:C9H7FO2Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:166.15 g/mol



