
CAS 20595-44-2
:2,3-Dichlorocinnamic acid
Description:
2,3-Dichlorocinnamic acid is an organic compound characterized by its aromatic structure and the presence of two chlorine substituents on the cinnamic acid backbone. It features a trans configuration, which is significant for its biological activity and chemical reactivity. The compound typically appears as a white to pale yellow solid and is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. Its molecular formula is C9H6Cl2O2, indicating the presence of two chlorine atoms, which contribute to its unique properties, including increased lipophilicity and potential for various chemical reactions. 2,3-Dichlorocinnamic acid is of interest in organic synthesis and may exhibit biological activities, making it a subject of study in medicinal chemistry. Its reactivity can be attributed to the presence of the carboxylic acid functional group, which can participate in various chemical transformations. Safety precautions should be taken when handling this compound, as with many chlorinated organic substances, due to potential toxicity and environmental concerns.
Formula:C9H6Cl2O2
InChI:InChI=1/C9H6Cl2O2/c10-7-3-1-2-6(9(7)11)4-5-8(12)13/h1-5H,(H,12,13)/b5-4+
Synonyms:- (2E)-3-(2,3-dichlorophenyl)prop-2-enoate
- (2E)-3-(2,3-dichlorophenyl)prop-2-enoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(2E)-3-(2,3-dichlorophenyl)prop-2-enoic acid
CAS:Formula:C9H6Cl2O2Purity:97%Color and Shape:SolidMolecular weight:217.04872,3-Dichlorocinnamic acid
CAS:2,3-Dichlorocinnamic acid is an organic compound that can be synthesized in a multistep process involving the reaction of pyridine with sulfuryl chloride. This reaction forms 2,3-dichloropropiophenone and 2,3-dichloroacetophenone. The latter compound is converted to the desired product by reacting it with thionyl chloride. The final step involves hydrolysis of the ester group to form 2,3-dichlorocinnamic acid. 2,3-Dichlorocinnamic acid can also be synthesized from phenylpropiolic acid and chlorosulfuric acid or from methyl propiolate and chlorosulfuric acid. 2,3-Dichlorocinnamic acid is a white crystalline solid that melts at 155°C and boils at 287°C. It is soluble in water and has a low yield due toFormula:C9H6Cl2O2Purity:Min. 95%Molecular weight:217.05 g/mol


