CAS 20596-93-4

Acetic acid, magnesium uranium(4+) salt (6:1:1)

Description:

Acetic acid, magnesium uranium(4+) salt (6:1:1), with the CAS number 20596-93-4, is a complex inorganic compound that consists of magnesium, uranium, and acetic acid in a specific stoichiometric ratio. This compound typically exhibits characteristics associated with both its metal constituents and the acetic acid moiety. It is likely to be a crystalline solid at room temperature, with potential solubility in polar solvents due to the presence of acetic acid. The uranium component, being in the +4 oxidation state, suggests that the compound may have specific radiological and chemical properties, including potential radioactivity and unique coordination chemistry. The magnesium ion can contribute to the stability and solubility of the compound. In terms of applications, such compounds may be of interest in nuclear chemistry, materials science, or as precursors in the synthesis of other uranium-containing materials. Safety precautions are essential when handling this compound due to the presence of uranium, which poses health risks if not managed properly.

Formula: C₂H₄O₂MgU

InChI: InChI=1S/C2H4O2.Mg.U/c1-2(3)4;;/h1H3,(H,3,4);;

InChI key: InChIKey=WGLRZKCSIMZPMQ-UHFFFAOYSA-N

SMILES: C(C)(O)=O.[Mg].[U]

Synonyms:

• Acetic acid, magnesium uranium(4+) salt (6:1:1)

Uranyl Magnesium Acetate extrapure, 98%

CAS: 20596-93-4

Formula: C₈H₁₂MgO₁₀U

Purity: min. 98%

Color and Shape: Greenish yellow to bright yellow, Crystalline powder, Clear to slight opalascent

Molecular weight: 530.51

Ref: SR-70780