CAS 205985-91-7
:(2R,4S)-2-methyl-1,3-thiazolidine-4-carboxylic acid
Description:
(2R,4S)-2-methyl-1,3-thiazolidine-4-carboxylic acid, also known as a thiazolidine derivative, is characterized by its unique thiazolidine ring structure, which incorporates a sulfur atom and a carboxylic acid functional group. This compound exhibits chirality, with specific stereochemistry at the 2 and 4 positions, contributing to its potential biological activity. The presence of the methyl group at the 2-position and the carboxylic acid at the 4-position influences its solubility and reactivity. Thiazolidine derivatives are often studied for their roles in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to interact with biological targets. The compound may exhibit properties such as antioxidant activity or involvement in metabolic pathways. Its CAS number, 205985-91-7, allows for easy identification in chemical databases. Overall, this compound's structural features and stereochemistry make it a subject of interest in both synthetic and medicinal chemistry research.
Formula:C5H9NO2S
InChI:InChI=1/C5H9NO2S/c1-3-6-4(2-9-3)5(7)8/h3-4,6H,2H2,1H3,(H,7,8)/t3-,4-/m1/s1
Synonyms:- (4S,2RS)-2-METHYLTHIAZOLIDINE-4-CARBOXYLIC ACID
- 4-Thiazolidinecarboxylicacid,2-methyl-,(4S)-(9CI)
- (4S,2RS)-2-Methylthiazolidine-4-carboxylic acid,97%
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
