
CAS 20599-77-3
:Decanoic acid, compd. with morpholine (1:1)
Description:
Decanoic acid, compd. with morpholine (1:1), also known as morpholine decanoate, is a chemical compound formed from the reaction of decanoic acid, a saturated fatty acid with a ten-carbon chain, and morpholine, a cyclic amine. This compound typically exhibits characteristics associated with both its components. Decanoic acid contributes to its fatty, waxy odor and hydrophobic nature, while morpholine adds basicity and potential solubility in polar solvents. The compound may appear as a viscous liquid or solid, depending on temperature and purity. It is often used in various applications, including as a surfactant, emulsifier, or in the synthesis of other chemical products. The presence of both the fatty acid and the morpholine moiety can impart unique properties, such as improved solubility in organic solvents and potential biological activity. Safety considerations should be taken into account, as both components can have irritant properties. Proper handling and storage conditions are essential to ensure stability and minimize exposure risks.
Formula:C10H20O2·C4H9NO
InChI:InChI=1S/C10H20O2.C4H9NO/c1-2-3-4-5-6-7-8-9-10(11)12;1-3-6-4-2-5-1/h2-9H2,1H3,(H,11,12);5H,1-4H2
InChI key:InChIKey=NBSJLWVJXSBMPD-UHFFFAOYSA-N
SMILES:C(CCCCCC)CCC(O)=O.C1COCCN1
Synonyms:- Morpholine, decanoate
- Morpholine caprate
- Decanoic acid morpholine salt
- Decanoic acid, compd. with morpholine (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Morpholine decanoate
CAS:Morpholine decanoate is a biochemical.Formula:C14H29NO3Color and Shape:SolidMolecular weight:259.39

