CAS 2059988-69-9

Benzenemethanamine, 4-bromo-2,5-difluoro-, hydrochloride (1:1)

Description:

Benzenemethanamine, 4-bromo-2,5-difluoro-, hydrochloride (1:1), with the CAS number 2059988-69-9, is a chemical compound characterized by its aromatic amine structure. It features a benzene ring substituted with a bromine atom and two fluorine atoms at specific positions, contributing to its unique reactivity and properties. The presence of the amine group (-NH2) indicates that it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in biological and pharmaceutical applications. The fluorine and bromine substituents can influence the compound's electronic properties, potentially affecting its biological activity and interaction with other molecules. This compound may be of interest in medicinal chemistry for the development of new therapeutic agents or as a building block in organic synthesis. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.

Formula: C₇H₆BrF₂N·ClH

InChI: InChI=1S/C7H6BrF2N.ClH/c8-5-2-6(9)4(3-11)1-7(5)10;/h1-2H,3,11H2;1H

InChI key: InChIKey=ABFWCVBXTWZQBC-UHFFFAOYSA-N

SMILES: C(N)C1=C(F)C=C(Br)C(F)=C1.Cl

Synonyms:

• Benzenemethanamine, 4-bromo-2,5-difluoro-, hydrochloride (1:1)

(4-Bromo-2,5-difluorophenyl)methanamine hydrochloride

CAS: 2059988-69-9

Versatile small molecule scaffold

Formula: C₇H₇BrClF₂N

Purity: Min. 95%

Molecular weight: 258.49 g/mol

Ref: 3D-JHD98869