CAS 2060-55-1
:2,2'-bithiophene-5-carboxylic acid
Description:
2,2'-Bithiophene-5-carboxylic acid is an organic compound characterized by its structure, which consists of two thiophene rings connected by a carbon-carbon bond, with a carboxylic acid functional group (-COOH) attached to one of the thiophene rings. This compound is known for its potential applications in organic electronics, particularly in organic semiconductors and photovoltaic devices, due to the conjugated system provided by the thiophene units, which allows for effective charge transport. It typically exhibits good solubility in organic solvents, making it suitable for various synthetic processes. The presence of the carboxylic acid group enhances its reactivity, allowing for further functionalization and incorporation into larger molecular architectures. Additionally, 2,2'-bithiophene-5-carboxylic acid may display interesting optical properties, including absorption in the UV-visible region, which is beneficial for applications in optoelectronic materials. Its stability and reactivity can vary depending on the specific conditions and environment in which it is used.
Formula:C9H6O2S2
InChI:InChI=1/C9H6O2S2/c10-9(11)8-4-3-7(13-8)6-2-1-5-12-6/h1-5H,(H,10,11)
SMILES:c1cc(c2ccc(C(=O)O)s2)sc1
Synonyms:- 2,2'-Bithiophene-5-CA
- 2,2'-Bithiophene-5-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
[2,2'-Bithiophene]-5-carboxylic acid
CAS:Formula:C9H6O2S2Purity:98%Color and Shape:SolidMolecular weight:210.27272,2'-Bithiophene-5-carboxylic acid
CAS:2,2'-Bithiophene-5-carboxylic acidFormula:C9H6O2S2Purity:≥95%Color and Shape: light green solidMolecular weight:210.27g/mol2,2-Bithiophene-5-carboxylic acid
CAS:2,2-Bithiophene-5-carboxylic acid is an organic compound that has a carboxylate group. It is used as a monomer in the preparation of polymers and plastics. It absorbs light in the visible region and fluoresces with a blue color when irradiated with ultraviolet light. The nature of this compound's absorption spectrum changes depending on whether it is in the solid or liquid state. 2,2-Bithiophene-5-carboxylic acid has been shown to have significant anti-inflammatory activity. This may be due to its ability to inhibit cyclooxygenase enzymes, which are responsible for producing prostaglandins from arachidonic acid.
Formula:C9H6O2S2Purity:Min. 95%Molecular weight:210.27 g/mol



