CAS 2060-63-1

1-benzothiophene-5-carbonitrile

Description:

1-Benzothiophene-5-carbonitrile is an organic compound characterized by its unique structure, which consists of a benzothiophene ring fused with a cyano group at the 5-position. This compound features a heterocyclic structure, incorporating both sulfur and carbon atoms, which contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. The presence of the cyano group enhances its polarity and can influence its solubility in different solvents. Typically, compounds like 1-benzothiophene-5-carbonitrile exhibit interesting electronic properties due to the conjugation between the aromatic system and the cyano group, making them valuable in organic synthesis and as intermediates in the production of more complex molecules. Additionally, the compound may exhibit biological activity, which warrants further investigation for potential therapeutic applications. Its CAS number, 2060-63-1, is a unique identifier that facilitates the search for information regarding its properties, safety data, and regulatory status in chemical databases.

Formula: C₉H₅NS

InChI: InChI=1/C9H5NS/c10-6-7-1-2-9-8(5-7)3-4-11-9/h1-5H

SMILES: c1cc2c(ccs2)cc1C#N

Synonyms:

• Benzo[b]thiophene-5-carbonitrile
• 1-Benzothiophene-5-carbonitrile

benzo[b]thiophene-5-carbonitrile

CAS: 2060-63-1

Formula: C₉H₅NS

Purity: 98%

Color and Shape: Solid

Molecular weight: 159.2077

Ref: IN-DA002AGW

1-Benzothiophene-5-carbonitrile

CAS: 2060-63-1

1-Benzothiophene-5-carbonitrile

Purity: 95%

Color and Shape: Solid

Molecular weight: 159.21g/mol

Ref: 54-OR350057

1-Benzothiophene-5-carbonitrile

CAS: 2060-63-1

Formula: C₉H₅NS

Purity: 95%

Color and Shape: Solid

Molecular weight: 159.21

Ref: 10-F221673

1-Benzothiophene-5-carbonitrile

CAS: 2060-63-1

1-Benzothiophene-5-carbonitrile is a heterocyclic compound that is formed by condensation of ethyl azidoacetate with indole under catalysis. It can be used in the synthesis of heterocycles. The yield of 1-benzothiophene-5-carbonitrile is about 56%.

Formula: C₉H₅NS

Purity: Min. 95%

Molecular weight: 159.21 g/mol

Ref: 3D-CAA06063