CAS 2060-64-2

Benzo[b]thiophene-5-carboxylic acid

Description:

Benzo[b]thiophene-5-carboxylic acid is an organic compound characterized by its fused ring structure, which includes a benzene ring and a thiophene ring. This compound features a carboxylic acid functional group (-COOH) at the 5-position of the thiophene ring, contributing to its acidic properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in various fields, including organic synthesis and materials science, due to its potential applications in pharmaceuticals and as a building block for more complex molecules. Its unique structure allows for interesting electronic properties, making it a candidate for studies in organic electronics and photonics. Additionally, benzo[b]thiophene derivatives are often investigated for their biological activities, including antimicrobial and anti-inflammatory properties. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₉H₆O₂S

InChI: InChI=1S/C9H6O2S/c10-9(11)7-1-2-8-6(5-7)3-4-12-8/h1-5H,(H,10,11)

InChI key: InChIKey=SNBYTKLWZRHESA-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C2C(=CC1)SC=C2

Synonyms:

• Benzothiophene-5-carboxylic acid
• Benzo[b]thiophene-5-carboxylic acid
• 1-Benzothiophene-5-carboxylic acid

1-Benzothiophene-5-carboxylic acid

CAS: 2060-64-2

Formula: C₉H₆O₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 178.2077

Ref: IN-DA002AGV

Benzo[b]thiophene-5-carboxylic acid

CAS: 2060-64-2

Benzo[b]thiophene-5-carboxylic acid

Formula: C₉H₆O₂S

Purity: 98%

Color and Shape: white solid

Molecular weight: 178.21g/mol

Ref: 54-OR400942

Benzo[b]thiophene-5-carboxylic acid

CAS: 2060-64-2

Formula: C₉H₆O₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 178.21

Ref: 10-F325184