CAS 2060006-04-2

2-Oxabicyclo[2.1.1]hexane-1-methanesulfonyl chloride

Description:

2-Oxabicyclo[2.1.1]hexane-1-methanesulfonyl chloride is a chemical compound characterized by its bicyclic structure, which includes a sulfonyl chloride functional group. This compound features a bicyclo[2.1.1]hexane framework, where one of the carbon atoms is replaced by an oxygen atom, forming an oxabicyclic system. The presence of the methanesulfonyl chloride group indicates that it is a sulfonyl chloride derivative, which typically exhibits high reactivity, particularly in nucleophilic substitution reactions. This reactivity makes it useful in organic synthesis, particularly for the introduction of sulfonyl groups into various substrates. The compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is important to handle this substance with care due to the potential hazards associated with sulfonyl chlorides, including their corrosive nature and ability to release toxic gases upon reaction with water or moisture. Proper safety protocols should be followed when working with this compound in a laboratory setting.

Formula: C₆H₉ClO₃S

InChI: InChI=1S/C6H9ClO3S/c7-11(8,9)4-6-1-5(2-6)3-10-6/h5H,1-4H2

InChI key: InChIKey=CBBHWYZBQOJCMB-UHFFFAOYSA-N

SMILES: C(S(Cl)(=O)=O)C12CC(C1)CO2

Synonyms:

• 2-Oxabicyclo[2.1.1]hexane-1-methanesulfonyl chloride

{2-Oxabicyclo[2.1.1]hexan-1-yl}methanesulfonyl chloride

CAS: 2060006-04-2

Versatile small molecule scaffold

Formula: C₆H₉ClO₃S

Purity: Min. 95%

Molecular weight: 196.65 g/mol

Ref: 3D-KHD00604