CAS 2060030-53-5

6-Chloro-2,4-diethyl-3-propylquinoline

Description:

6-Chloro-2,4-diethyl-3-propylquinoline is a synthetic organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. The presence of a chlorine atom at the 6-position and ethyl groups at the 2 and 4 positions, along with a propyl group at the 3-position, contributes to its unique chemical properties. This compound may exhibit various biological activities, potentially making it of interest in pharmaceutical research. Its molecular structure suggests it could participate in various chemical reactions typical of quinoline derivatives, such as electrophilic substitutions or nucleophilic attacks. The compound's solubility, stability, and reactivity would depend on the specific functional groups and their arrangement, influencing its applications in medicinal chemistry or as a building block in organic synthesis. As with many quinoline derivatives, it may also display fluorescence properties, which can be useful in analytical applications. Safety and handling precautions should be observed due to the presence of chlorine and the potential for biological activity.

Formula: C₁₆H₂₀ClN

InChI: InChI=1S/C16H20ClN/c1-4-7-13-12(5-2)14-10-11(17)8-9-16(14)18-15(13)6-3/h8-10H,4-7H2,1-3H3

InChI key: InChIKey=VTKKFBFVOKYQMN-UHFFFAOYSA-N

SMILES: C(C)C=1C2=C(N=C(CC)C1CCC)C=CC(Cl)=C2

Synonyms:

• 6-Chloro-2,4-diethyl-3-propylquinoline
• Quinoline, 6-chloro-2,4-diethyl-3-propyl-