CymitQuimica logo

CAS 2060063-38-7

:

N-(2,2-Diethoxyethyl)-4-iodo-1H-pyrrole-2-carboxamide

Description:
N-(2,2-Diethoxyethyl)-4-iodo-1H-pyrrole-2-carboxamide is a chemical compound characterized by its unique structure, which includes a pyrrole ring substituted with an iodine atom and a carboxamide functional group. The presence of the diethoxyethyl group enhances its solubility and may influence its biological activity. This compound is likely to exhibit properties typical of pyrrole derivatives, such as potential reactivity in electrophilic substitution reactions due to the electron-rich nature of the pyrrole ring. Additionally, the iodine substituent can impart specific characteristics, such as increased lipophilicity and potential for halogen bonding. The carboxamide group may contribute to hydrogen bonding capabilities, affecting its interaction with biological targets. Overall, this compound may be of interest in medicinal chemistry and materials science, particularly in the development of pharmaceuticals or functional materials, due to its structural features and potential reactivity. However, specific applications and biological activities would require further investigation through experimental studies.
Formula:C11H17IN2O3
InChI:InChI=1S/C11H17IN2O3/c1-3-16-10(17-4-2)7-14-11(15)9-5-8(12)6-13-9/h5-6,10,13H,3-4,7H2,1-2H3,(H,14,15)
InChI key:InChIKey=IOUDKSKYBADFKN-UHFFFAOYSA-N
SMILES:C(NCC(OCC)OCC)(=O)C1=CC(I)=CN1
Synonyms:
  • 1H-Pyrrole-2-carboxamide, N-(2,2-diethoxyethyl)-4-iodo-
  • N-(2,2-Diethoxyethyl)-4-iodo-1H-pyrrole-2-carboxamide
Found 1 products.