CAS 20601-22-3

2-Bromo-1-methylnaphthalene

Description:

2-Bromo-1-methylnaphthalene is an organic compound characterized by its structure, which consists of a naphthalene ring substituted with a bromine atom and a methyl group. It is a member of the naphthalene derivatives and is typically a colorless to pale yellow liquid or solid, depending on the temperature. This compound is known for its aromatic properties, which contribute to its stability and reactivity. It has a relatively high boiling point and low solubility in water, making it more soluble in organic solvents. 2-Bromo-1-methylnaphthalene is utilized in various chemical synthesis processes, particularly in the production of pharmaceuticals and agrochemicals. Its reactivity is influenced by the presence of the bromine atom, which can participate in nucleophilic substitution reactions. Additionally, this compound may exhibit biological activity, although specific effects can vary based on concentration and exposure. Safety precautions should be taken when handling this substance, as it may pose health risks if inhaled or ingested.

Formula: C₁₁H₉Br

InChI: InChI=1S/C11H9Br/c1-8-10-5-3-2-4-9(10)6-7-11(8)12/h2-7H,1H3

InChI key: InChIKey=AEJFBKVIGAYAQV-UHFFFAOYSA-N

SMILES: CC=1C2=C(C=CC1Br)C=CC=C2

Synonyms:

• 2-Bromo-1-methylnaphthalene
• Naphthalene, 2-bromo-1-methyl-

Naphthalene, 2-bromo-1-methyl-

CAS: 20601-22-3

Formula: C₁₁H₉Br

Purity: 95%

Color and Shape: Liquid

Molecular weight: 221.0932

Ref: IN-DA002AHT

2-Bromo-1-methylnaphthalene

CAS: 20601-22-3

2-Bromo-1-methylnaphthalene

Formula: C₁₁H₉Br

Purity: 95%

Color and Shape: orange oil

Molecular weight: 221.09g/mol

Ref: 54-OR310251

2-Bromo-1-methylnaphthalene

CAS: 20601-22-3

Purity: 98%

Molecular weight: 221.0970001

Ref: 10-F637457

2-Bromo-1-methylnaphthalene

CAS: 20601-22-3

2-Bromo-1-methylnaphthalene is the chemical compound with the formula C6H5BrCH2. It is a brominated derivative of naphthalene. This compound is an intermediate in the synthesis of arylboronic acids, which are used as coupling partners in Suzuki and Miyaura cross-coupling reactions. It also has been used as a catalyst for indole synthesis from chlorobenzene and ammonia. 2-Bromo-1-methylnaphthalene can be prepared by treating naphthalene with bromine and potassium t-butoxide at low temperature. The reaction can also be conducted using chloride or potassium instead of t-butoxide.
2-Bromo-1methyhnaphthalene is a useful chemical because it can react efficiently with aryl bromides to produce coupling products, such as benzofuran derivatives, in high yield.

Formula: C₁₁H₉Br

Purity: Min. 95%

Molecular weight: 221.09 g/mol

Ref: 3D-VAA60122