CAS 206054-37-7

2-Chloro-N-(2-nitrophenyl)propanamide

Description:

2-Chloro-N-(2-nitrophenyl)propanamide is an organic compound characterized by its amide functional group, which is linked to a propanamide backbone. The presence of a chlorine atom and a nitrophenyl group contributes to its unique chemical properties. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its non-polar characteristics due to the aromatic nitrophenyl moiety. The chlorine substituent can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The nitro group, being electron-withdrawing, can affect the electronic properties of the molecule, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical research. Safety data should be consulted, as compounds containing chlorine and nitro groups can pose health risks and environmental concerns. Overall, 2-Chloro-N-(2-nitrophenyl)propanamide serves as a valuable compound in synthetic organic chemistry and medicinal chemistry applications.

Formula: C₉H₉ClN₂O₃

InChI: InChI=1S/C9H9ClN2O3/c1-6(10)9(13)11-7-4-2-3-5-8(7)12(14)15/h2-6H,1H3,(H,11,13)

InChI key: InChIKey=RUGNNTYZTSTHKK-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(NC(C(C)Cl)=O)C=CC=C1

Synonyms:

• 2-Chloro-N-(2-nitro-phenyl)-propionamide
• Propanamide, 2-chloro-N-(2-nitrophenyl)-
• 2-Chloro-N-(2-nitrophenyl)propanamide

2-Chloro-N-(2-nitrophenyl)propanamide

CAS: 206054-37-7

Please enquire for more information about 2-Chloro-N-(2-nitrophenyl)propanamide including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₉H₉ClN₂O₃

Purity: Min. 95%

Molecular weight: 228.63 g/mol

Ref: 3D-FC114011