CymitQuimica logo

CAS 206055-75-6

:

DMT-2'-O-4'-C-Locked-T-CE-Phosphoramidite

Description:
DMT-2'-O-4'-C-Locked-T-CE-Phosphoramidite is a specialized chemical compound primarily used in the field of nucleic acid chemistry, particularly in the synthesis of oligonucleotides. This compound features a dimethoxytrityl (DMT) protecting group, which is crucial for the selective protection of the 5' hydroxyl group during oligonucleotide synthesis. The "2'-O-4'-C-Locked" designation indicates a specific structural modification that enhances the stability and binding properties of the nucleoside, often improving the overall efficiency of the synthesis process. The "T" refers to the thymidine base, while "CE" denotes a cyanoethyl group, which is commonly used in phosphoramidite chemistry to facilitate the coupling reactions. The phosphoramidite functional group allows for the formation of phosphodiester bonds, essential for linking nucleotides together. Overall, this compound is significant in the development of synthetic DNA and RNA, with applications in research, diagnostics, and therapeutic development. Its unique structural features contribute to its utility in producing high-fidelity oligonucleotides.
Formula:C41H49N4O9P
InChI:InChI=1S/C41H49N4O9P/c1-27(2)45(28(3)4)55(52-23-11-22-42)54-36-35-38(44-24-29(5)37(46)43-39(44)47)53-40(36,25-50-35)26-51-41(30-12-9-8-10-13-30,31-14-18-33(48-6)19-15-31)32-16-20-34(49-7)21-17-32/h8-10,12-21,24,27-28,35-36,38H,11,23,25-26H2,1-7H3,(H,43,46,47)/t35-,36?,38-,40-,55?/m1/s1
InChI key:STPXOEPMLLHUDQ-DMMPMGKKSA-N
SMILES:CC1=CN(C(=O)NC1=O)[C@H]2[C@H]3C([C@@](O2)(CO3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)OP(N(C(C)C)C(C)C)OCCC#N
Found 7 products.