CymitQuimica logo

CAS 206060-40-4

:

L-Phenylalanine,N-[(9H-fluoren-9-ylmethoxy)carbonyl]-3-methoxy-

Description:
L-Phenylalanine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-3-methoxy- is a derivative of the amino acid phenylalanine, which is essential for protein synthesis and serves as a precursor for various neurotransmitters. This compound features a fluorenylmethoxycarbonyl (Fmoc) protecting group, commonly used in peptide synthesis to protect the amino group during chemical reactions. The presence of a methoxy group at the 3-position of the phenylalanine side chain may influence the compound's solubility and reactivity. The Fmoc group is typically removed under basic conditions, allowing for further functionalization or coupling in peptide synthesis. This compound is primarily utilized in research and pharmaceutical applications, particularly in the development of peptide-based drugs. Its structural characteristics contribute to its stability and reactivity, making it a valuable intermediate in organic synthesis and biochemistry. As with many chemical substances, proper handling and safety precautions are essential due to potential hazards associated with its use.
Formula:C25H23NO5
InChI:InChI=1S/C25H23NO5/c1-30-17-8-6-7-16(13-17)14-23(24(27)28)26-25(29)31-15-22-20-11-4-2-9-18(20)19-10-3-5-12-21(19)22/h2-13,22-23H,14-15H2,1H3,(H,26,29)(H,27,28)/t23-/m0/s1
InChI key:IKKQVAWYVGALAQ-QHCPKHFHSA-N
SMILES:COC1=CC=CC(=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24
Found 4 products.