CAS 2061-71-4
:(4aS,4bR,6aS,8S,10aS,10bS,12aS)-8-hydroxy-10a,12a-dimethylhexadecahydro-2H-naphtho[2,1-f]chromen-2-one
Description:
The chemical substance with the name "(4aS,4bR,6aS,8S,10aS,10bS,12aS)-8-hydroxy-10a,12a-dimethylhexadecahydro-2H-naphtho[2,1-f]chromen-2-one" and CAS number "2061-71-4" is a complex organic compound characterized by its polycyclic structure, which includes a naphtho-chromene framework. This compound features multiple stereocenters, contributing to its specific three-dimensional configuration and potentially influencing its biological activity. The presence of a hydroxyl group indicates that it may exhibit properties typical of phenolic compounds, such as antioxidant activity. Its hexadecahydro structure suggests a saturated framework, which may affect its solubility and reactivity. This compound is of interest in various fields, including medicinal chemistry and natural product research, due to its potential therapeutic applications. The intricate stereochemistry and functional groups present in this molecule may also play a significant role in its interactions with biological systems, making it a subject of study for understanding structure-activity relationships in drug development.
Formula:C19H30O3
InChI:InChI=1/C19H30O3/c1-18-9-7-13(20)11-12(18)3-4-14-15(18)8-10-19(2)16(14)5-6-17(21)22-19/h12-16,20H,3-11H2,1-2H3/t12-,13-,14+,15-,16-,18-,19-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2H-Phenanthro[2,1-b]pyran-2-one, hexadecahydro-8-hydroxy-10a,12a-dimethyl-, (4aS,4bR,6aS,8S,10aS,10bS,12aS)-
CAS:Formula:C19H30O3Molecular weight:306.4397Isoandrololactone
CAS:Controlled Product<p>Isoandrololactone is a potent anticancer agent that has been shown to induce apoptosis in human and Chinese hamster ovary cancer cells. It is a natural product that can be isolated from the urine of patients treated with oseltamivir, an analog of the antiviral drug Tamiflu. Isoandrololactone works by inhibiting protein kinases, which are enzymes that play a key role in cell signaling pathways involved in tumor growth and survival. This inhibition leads to the suppression of tumor cell proliferation and promotes apoptosis, or programmed cell death. Isoandrololactone has been identified as a promising lead compound for the development of novel kinase inhibitors for cancer therapy.</p>Formula:C19H30O3Purity:Min. 95%Molecular weight:306.4 g/mol


