CAS 2061980-49-0: 1-Azetidinecarboxylic acid, 3-(1-piperazinyl)-, 1,1-dimethylethyl ester, hydrochloride (1:2)

Description:1-Azetidinecarboxylic acid, 3-(1-piperazinyl)-, 1,1-dimethylethyl ester, hydrochloride (1:2) is a chemical compound characterized by its unique structural features, which include an azetidine ring and a piperazine moiety. This compound is typically classified as an amino acid derivative due to the presence of the carboxylic acid functional group. The hydrochloride salt form indicates that it is a protonated version, enhancing its solubility in polar solvents, particularly water. The presence of the tert-butyl ester group suggests that it may exhibit lipophilic properties, which can influence its biological activity and pharmacokinetics. This compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development, as the piperazine ring is often associated with various pharmacological activities. Additionally, the specific stereochemistry and functional groups can affect its reactivity and interactions with biological targets. Overall, this compound represents a complex structure with potential implications in pharmaceutical research.

Formula:C₁₂H₂₃N₃O₂·2ClH

InChI:InChI=1S/C12H23N3O2.2ClH/c1-12(2,3)17-11(16)15-8-10(9-15)14-6-4-13-5-7-14;;/h10,13H,4-9H2,1-3H3;2*1H

InChI key:InChIKey=PZRALZLWTQGVNT-UHFFFAOYSA-N

SMILES:Cl.O=C(OC(C)(C)C)N1CC(N2CCNCC2)C1

Synonyms:
1-Azetidinecarboxylic acid, 3-(1-piperazinyl)-, 1,1-dimethylethyl ester, hydrochloride (1:2)

Found 3 products.

Product data	Purity	Price range	Estimated delivery
tert-Butyl 3-(piperazin-1-yl)azetidine-1-carboxylate dihydrochloride REF: IN-DA01EN2ACAS: 2061980-49-0	97%	To inquire	Mon 14 Apr 25
Tert-Butyl 3-(piperazin-1-yl)azetidine-1-carboxylate dihydrochloride REF: 10-F054432CAS: 2061980-49-0	97.0%	To inquire	Thu 24 Apr 25
1-Boc-3-(1-piperazinyl)azetidine 2HCl REF: 3D-LHD98049CAS: 2061980-49-0	Min. 95%	- - -	Discontinued product