CAS 2061996-64-1

1,3-Benzodioxole-5-propanoic acid, β-amino-, methyl ester, hydrochloride (1:1), (βR)-

Description:

1,3-Benzodioxole-5-propanoic acid, β-amino-, methyl ester, hydrochloride (1:1), (βR)- is a chemical compound characterized by its unique structure that includes a benzodioxole moiety, which contributes to its aromatic properties and potential biological activity. The presence of a propanoic acid group indicates that it has carboxylic acid functionality, while the methyl ester suggests it can undergo hydrolysis to release the corresponding acid. The β-amino group introduces basic characteristics, which may influence its solubility and reactivity. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its potential for pharmaceutical applications. The (βR)- designation indicates a specific stereochemistry, which can be crucial for its biological activity and interaction with biological targets. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development.

Formula: C₁₁H₁₃NO₄·ClH

InChI: InChI=1S/C11H13NO4.ClH/c1-14-11(13)5-8(12)7-2-3-9-10(4-7)16-6-15-9;/h2-4,8H,5-6,12H2,1H3;1H/t8-;/m1./s1

InChI key: InChIKey=IVKKOAMWYVPZCG-DDWIOCJRSA-N

SMILES: [C@H](CC(OC)=O)(N)C=1C=C2C(=CC1)OCO2.Cl

Synonyms:

• 1,3-Benzodioxole-5-propanoic acid, β-amino-, methyl ester, hydrochloride (1:1), (βR)-

(R)-Methyl 3-amino-3-(benzo[d][1,3]dioxol-5-yl)propanoate hydrochloride

CAS: 2061996-64-1

Formula: C₁₁H₁₄ClNO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 259.6862

Ref: IN-DA01DU7R

(R)-Methyl 3-amino-3-(benzo[d][1,3]dioxol-5-yl)propanoate hydrochloride

CAS: 2061996-64-1

(R)-Methyl 3-amino-3-(benzo[d][1,3]dioxol-5-yl)propanoate hydrochloride

Purity: 95%

Molecular weight: 259.69g/mol

Ref: 54-OR1050726

Methyl (R)-3-amino-3-(benzo[d][1,3]dioxol-5-yl)propanoate hydrochloride

CAS: 2061996-64-1

Purity: 95%

Molecular weight: 259.6900024

Ref: 10-F733127