CymitQuimica logo

CAS 2061996-68-5

:

2-Pyridinemethanamine, α-methyl-5-(trifluoromethyl)-, hydrochloride (1:2), (αR)-

Description:
2-Pyridinemethanamine, α-methyl-5-(trifluoromethyl)-, hydrochloride (1:2), (αR)- is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a trifluoromethyl group, which significantly influences its chemical properties, including increased lipophilicity and potential biological activity. The presence of the α-methyl group contributes to its stereochemistry, specifically the (αR)- configuration, which can affect its interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The compound may exhibit properties such as basicity due to the amine functional group, and its trifluoromethyl substitution can impart unique reactivity and stability characteristics. Overall, this compound is of interest in medicinal chemistry and may be explored for its potential therapeutic applications, particularly in the development of new drugs.
Formula:C8H9F3N2·2ClH
InChI:InChI=1S/C8H9F3N2.2ClH/c1-5(12)7-3-2-6(4-13-7)8(9,10)11;;/h2-5H,12H2,1H3;2*1H/t5-;;/m1../s1
InChI key:InChIKey=MLLTXCGPJHCQRC-ZJIMSODOSA-N
SMILES:C(F)(F)(F)C=1C=CC([C@@H](C)N)=NC1.Cl
Synonyms:
  • 2-Pyridinemethanamine, α-methyl-5-(trifluoromethyl)-, hydrochloride (1:2), (αR)-
Found 2 products.