CAS 20624-87-7
:3-chloro-4,5-dimethoxybenzoic acid
Description:
3-Chloro-4,5-dimethoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of a benzoic acid core substituted with a chlorine atom and two methoxy groups. The chlorine atom is located at the meta position relative to the carboxylic acid group, while the methoxy groups are positioned at the para and ortho positions on the benzene ring. This compound is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. It exhibits acidic properties due to the carboxylic acid functional group, which can donate a proton in solution. The presence of the methoxy groups can influence its reactivity and polarity, making it a useful intermediate in organic synthesis and pharmaceuticals. Additionally, the compound may exhibit biological activity, although specific applications would depend on further research into its pharmacological properties. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C9H9ClO4
InChI:InChI=1/C9H9ClO4/c1-13-7-4-5(9(11)12)3-6(10)8(7)14-2/h3-4H,1-2H3,(H,11,12)
SMILES:COc1cc(cc(c1OC)Cl)C(=O)O
Synonyms:- Benzoic Acid, 3-Chloro-4,5-Dimethoxy-
- 3-Chloro-4,5-dimethoxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzoic acid, 3-chloro-4,5-dimethoxy-
CAS:Formula:C9H9ClO4Purity:95%Color and Shape:SolidMolecular weight:216.61843-Chloro-4,5-dimethoxybenzoic acid
CAS:3-Chloro-4,5-dimethoxybenzoic acidPurity:95%Molecular weight:216.62g/mol3-Chloro-4,5-dimethoxybenzoic acid
CAS:Please enquire for more information about 3-Chloro-4,5-dimethoxybenzoic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C9H9ClO4Purity:Min. 95%Molecular weight:216.62 g/molRef: 3D-VAA62487
1gTo inquire5gTo inquire100mgTo inquire250mgTo inquire500mgTo inquire2500mgTo inquire



