CAS 206261-63-4

2-[2-(dimethylamino)ethoxy]benzonitrile

Description:

2-[2-(Dimethylamino)ethoxy]benzonitrile, with the CAS number 206261-63-4, is an organic compound characterized by its structure, which includes a benzonitrile moiety and a dimethylaminoethoxy group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential solubility in various organic solvents. The presence of the dimethylamino group suggests basicity, which may influence its reactivity and interactions with other chemical species. Additionally, the benzonitrile part of the molecule indicates potential applications in pharmaceuticals or as a building block in organic synthesis due to its ability to participate in nucleophilic reactions. The compound may also display specific spectral characteristics in techniques such as NMR and IR spectroscopy, allowing for its identification and characterization in laboratory settings. Overall, 2-[2-(dimethylamino)ethoxy]benzonitrile is of interest in various fields, including medicinal chemistry and materials science, due to its unique structural features and functional groups.

Formula: C₁₁H₁₄N₂O

InChI: InChI=1/C11H14N2O/c1-13(2)7-8-14-11-6-4-3-5-10(11)9-12/h3-6H,7-8H2,1-2H3

SMILES: CN(C)CCOc1ccccc1C#N

2-(2-(Dimethylamino)ethoxy)benzonitrile

CAS: 206261-63-4

Formula: C₁₁H₁₄N₂O

Molecular weight: 190.2417

Ref: IN-DA002IDR

2-[2-(N,N-dimethylamino)ethoxy]benzonitrile

CAS: 206261-63-4

2-[2-(N,N-dimethylamino)ethoxy]benzonitrile

Purity: ≥95%

Molecular weight: 190.24g/mol

Ref: 54-OR300673

2-[2-(Dimethylamino)ethoxy]benzonitrile

Controlled Product

CAS: 206261-63-4

Versatile small molecule scaffold

Formula: C₁₁H₁₄N₂O

Purity: Min. 95%

Molecular weight: 190.25 g/mol

Ref: 3D-GIA26163