CymitQuimica logo

CAS 206274-21-7

:

tert-butyl 4-[3-(aminomethyl)-2-pyridyl]piperidine-1-carboxylate

Description:
Tert-butyl 4-[3-(aminomethyl)-2-pyridyl]piperidine-1-carboxylate is a chemical compound characterized by its complex structure, which includes a piperidine ring, a pyridine moiety, and a tert-butyl ester group. This compound typically exhibits properties associated with both amines and esters, such as potential solubility in polar organic solvents and moderate stability under standard conditions. The presence of the aminomethyl group suggests it may engage in hydrogen bonding, influencing its reactivity and interactions with biological targets. The pyridine ring contributes to its aromatic character, potentially affecting its electronic properties and reactivity. Additionally, the tert-butyl group enhances lipophilicity, which may influence the compound's pharmacokinetic properties if it is evaluated for biological activity. Overall, this compound's unique structural features make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways.
Formula:C16H25N3O2
InChI:InChI=1/C16H25N3O2/c1-16(2,3)21-15(20)19-9-6-12(7-10-19)14-13(11-17)5-4-8-18-14/h4-5,8,12H,6-7,9-11,17H2,1-3H3
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)c1c(cccn1)CN
Sort by

Found 3 products.