CymitQuimica logo

CAS 206278-27-5

:

2-Bromo-3-fluoropyrazine

Description:
2-Bromo-3-fluoropyrazine is a heterocyclic organic compound characterized by the presence of both bromine and fluorine substituents on a pyrazine ring. The pyrazine structure consists of a six-membered aromatic ring containing two nitrogen atoms at opposite positions, which contributes to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its reactivity due to the presence of halogen atoms, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. 2-Bromo-3-fluoropyrazine is often utilized in pharmaceutical and agrochemical research as a building block for the synthesis of more complex molecules. Its specific properties, such as solubility and stability, can vary based on the solvent and environmental conditions. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C4H2BrFN2
InChI:InChI=1S/C4H2BrFN2/c5-3-4(6)8-2-1-7-3/h1-2H
InChI key:InChIKey=QIDLQERJCKEQOL-UHFFFAOYSA-N
SMILES:BrC=1C(F)=NC=CN1
Synonyms:
  • Pyrazine, 2-bromo-3-fluoro-
  • 2-Bromo-3-fluoropyrazine
Found 5 products.