CAS 20628-27-7

2'-(Methylsulfonyl)acetanilide

Description:

2'-(Methylsulfonyl)acetanilide, with the CAS number 20628-27-7, is an organic compound that belongs to the class of acetanilides. It features a methylsulfonyl group (-SO2CH3) attached to the 2' position of an acetanilide structure, which consists of an aniline derivative with an acetyl group. This compound is typically characterized by its white crystalline solid form and exhibits moderate solubility in organic solvents. It is known for its potential applications in pharmaceuticals, particularly as an intermediate in the synthesis of various bioactive compounds. The presence of the methylsulfonyl group can influence the compound's reactivity and biological activity, often enhancing its solubility and stability. Additionally, 2'-(Methylsulfonyl)acetanilide may exhibit properties such as analgesic or anti-inflammatory effects, making it of interest in medicinal chemistry. As with many organic compounds, handling should be done with care, considering safety data and potential health effects.

Formula: C₉H₁₁NO₃S

InChI: InChI=1/C9H11NO3S/c1-7(11)10-8-5-3-4-6-9(8)14(2,12)13/h3-6H,1-2H3,(H,10,11)

SMILES: CC(=Nc1ccccc1S(=O)(=O)C)O

Synonyms:

• N-[2-(methylsulfonyl)phenyl]acetamide

Acetamide, N-[2-(methylsulfonyl)phenyl]-

CAS: 20628-27-7

Formula: C₉H₁₁NO₃S

Purity: 97%

Molecular weight: 213.2535

Ref: IN-DA002IES

N-Acetyl-2-(methylsulphonyl)aniline

CAS: 20628-27-7

N-Acetyl-2-(methylsulphonyl)aniline

Formula: C₉H₁₁NO₃S

Purity: ≥95%

Color and Shape: faint to light brown crystalline solid

Molecular weight: 213.25g/mol

Ref: 54-OR5729

N-(2-(methylsulfonyl)phenyl)acetamide

CAS: 20628-27-7

Purity: 97%

Molecular weight: 213.25

Ref: 10-F771805