CAS 20633-84-5
:Lonicerin
Description:
Lonicerin, with the CAS number 20633-84-5, is a chemical compound primarily derived from the plant genus Lonicera, commonly known as honeysuckle. It is classified as a flavonoid glycoside, which means it consists of a flavonoid moiety linked to a sugar molecule. Lonicerin is known for its potential pharmacological properties, including anti-inflammatory, antioxidant, and antimicrobial activities. These characteristics make it of interest in both traditional medicine and modern pharmacology. The compound is typically found in various parts of the honeysuckle plant, contributing to its therapeutic effects. Lonicerin's solubility and stability can vary depending on the solvent and environmental conditions, which is important for its application in herbal formulations and supplements. Research continues to explore its mechanisms of action and potential health benefits, particularly in relation to its role in supporting immune function and overall wellness.
Formula:C27H30O15
InChI:InChI=1S/C27H30O15/c1-9-20(32)22(34)24(36)26(39-9)38-8-18-21(33)23(35)25(37)27(42-18)40-11-5-14(30)19-15(31)7-16(41-17(19)6-11)10-2-3-12(28)13(29)4-10/h2-7,9,18,20-30,32-37H,8H2,1H3/t9-,18+,20-,21+,22+,23-,24+,25+,26+,27+/m0/s1
InChI key:InChIKey=MGYBYJXAXUBTQF-FOBVWLSUSA-N
SMILES:O=C1C=2C(OC(=C1)C3=CC(O)=C(O)C=C3)=CC(O[C@@H]4O[C@H](CO[C@H]5[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O5)[C@@H](O)[C@H](O)[C@H]4O)=CC2O
Synonyms:- Glucopyranoside, luteolin-7 6-O-(6-deoxy-α-L-mannopyranosyl)-, β-D-
- Luteolin 7-rutinoside
- Scolymoside
- 7-[[6-O-(6-Deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-2-(3,4-dihydroxyphenyl)-5-hydroxy-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 7-[[6-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-2-(3,4-dihydroxyphenyl)-5-hydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Luteolin-7-O-rutinoside
CAS:Luteolin-7-O-rutinoside analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C27H30O15Purity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:594.532-(3,4-Dihydroxyphenyl)-5-hydroxy-7-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-((((2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyltetrahydro-2H-pyran-2-yl)oxy)methyl)tetrahydro-2H-pyran-2-yl)oxy)-4H-chromen-4-on
CAS:2-(3,4-Dihydroxyphenyl)-5-hydroxy-7-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-((((2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyltetrahydro-2H-pyran-2-yl)oxy)methyl)tetrahydro-2H-pyran-2-yl)oxy)-4H-chromen-4-onPurity:98%Molecular weight:594.52g/molLuteolin-7-rutinoside
CAS:Luteolin-7-rutinoside is a natural product that alleviates acute liver injury by inhibiting PI3K/AKT/AMPK/NF-κB nd suppressing TNF-α, IL-6, and IL-1β.Formula:C27H30O15Purity:99.99%Color and Shape:SolidMolecular weight:594.52Luteolin-7-rutinoside
CAS:<p>Luteolin-7-rutinoside is a flavonoid glycoside, which is typically sourced from various plant species, including Japanese honeysuckle and passionflower. This compound is known for its strong antioxidant and anti-inflammatory activities. The mode of action of Luteolin-7-rutinoside involves the modulation of several signaling pathways and inhibition of oxidative stress at the molecular level. This is achieved by scavenging free radicals and reducing the expression of pro-inflammatory cytokines. As a result, it can mitigate cellular damage and inflammation.</p>Formula:C27H30O15Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:594.52 g/molLuteolin 7-O-Rutinoside
CAS:Controlled ProductFormula:C27H30O15Color and Shape:NeatMolecular weight:594.52








