CAS 20633-93-6
:5-hydroxy-2-(4-methoxyphenyl)-4-oxo-4H-chromen-7-yl 2-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranoside
Description:
5-Hydroxy-2-(4-methoxyphenyl)-4-oxo-4H-chromen-7-yl 2-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranoside, with CAS number 20633-93-6, is a complex glycosylated flavonoid compound. This substance features a chromone backbone, characterized by a fused benzopyran structure, which contributes to its potential biological activities, including antioxidant and anti-inflammatory properties. The presence of the methoxyphenyl group enhances its lipophilicity and may influence its interaction with biological targets. The glycosylation at the 2-position with a 6-deoxy-alpha-L-mannopyranosyl moiety and a beta-D-glucopyranoside unit suggests that this compound may exhibit enhanced solubility and bioavailability compared to its aglycone counterparts. Such structural features often play a crucial role in the pharmacokinetics and pharmacodynamics of flavonoids. Overall, this compound's unique structure may contribute to various therapeutic applications, although specific biological activities would require further investigation through experimental studies.
Formula:C28H32O14
InChI:InChI=1/C28H32O14/c1-11-21(32)23(34)25(36)27(38-11)42-26-24(35)22(33)19(10-29)41-28(26)39-14-7-15(30)20-16(31)9-17(40-18(20)8-14)12-3-5-13(37-2)6-4-12/h3-9,11,19,21-30,32-36H,10H2,1-2H3/t11-,19+,21-,22+,23+,24-,25+,26+,27-,28+/m0/s1
Synonyms:- Acacetin-7-neohesperidoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Fortunellin
CAS:Fortunellin analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C28H32O14Purity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:592.56Fortunellin
CAS:Fortunellin, a flavonoid from kumquat, reduces inflammation and oxidative stress in metabolic disease, improving cardiac function via NF-κB suppression and antioxidant activation.Formula:C28H32O14Purity:98.38%Color and Shape:SolidMolecular weight:592.55Acacetin-7-neohesperidoside
CAS:<p>Acacetin-7-neohesperidoside is a chemical compound that is classified as a flavonoid glycoside. Derived from various plant sources, particularly those within the Asteraceae family, it serves as a key subject in scientific investigations due to its diverse biological activities. The mode of action is primarily linked to its ability to modulate signaling pathways within cells, exhibiting potential anti-inflammatory and antioxidant effects. As a researcher, understanding its interaction with cellular pathways is crucial for advancing therapeutic applications.</p>Formula:C28H32O14Purity:Min. 98 Area-%Color and Shape:Pale yellow solid.Molecular weight:592.55 g/mol



