CAS 206357-78-0

tributyl-(3-chloro-2-pyridyl)stannane

Description:

Tributyl-(3-chloro-2-pyridyl)stannane is an organotin compound characterized by the presence of a tributyl group and a 3-chloro-2-pyridyl moiety. This compound typically exhibits a high degree of lipophilicity due to the bulky tributyl groups, which can influence its solubility and reactivity in various environments. Organotin compounds are known for their applications in agriculture, particularly as biocides and fungicides, owing to their ability to disrupt biological processes in target organisms. The presence of the chloro-substituted pyridine ring may impart specific biological activity and enhance the compound's interaction with biological targets. Additionally, tributyl-(3-chloro-2-pyridyl)stannane may exhibit toxicity, which necessitates careful handling and consideration of environmental impact. Its stability and reactivity can vary based on conditions such as temperature and pH, making it important to understand its behavior in different chemical contexts. Overall, this compound represents a class of organotin substances that are significant in both industrial and research applications.

Formula: C₁₇H₃₀ClNSn

InChI: InChI=1/C5H3ClN.3C4H9.Sn/c6-5-2-1-3-7-4-5;3*1-3-4-2;/h1-3H;3*1,3-4H2,2H3;/rC17H30ClNSn/c1-4-7-13-20(14-8-5-2,15-9-6-3)17-16(18)11-10-12-19-17/h10-12H,4-9,13-15H2,1-3H3

SMILES: CCCC[Sn](CCCC)(CCCC)c1c(cccn1)Cl

Synonyms:

• 3-Chloro-2-(tributylstannyl)pyridine
• Pyridine, 3-chloro-2-(tributylstannyl)-

Pyridine, 3-chloro-2-(tributylstannyl)-

CAS: 206357-78-0

Formula: C₁₇H₃₀ClNSn

Purity: 95%

Color and Shape: Liquid

Molecular weight: 402.5808

Ref: IN-DA002IFT

3-Chloro-2-(tributylstannyl)pyridine

CAS: 206357-78-0

3-Chloro-2-(tributylstannyl)pyridine

Purity: 95%

Molecular weight: 402.59g/mol

Ref: 54-IN12333

2-(Tributylstannyl)-3-chloropyridine

Controlled Product

CAS: 206357-78-0

Versatile small molecule scaffold

Formula: C₁₇H₃₀ClNSn

Purity: Min. 95%

Molecular weight: 402.59 g/mol

Ref: 3D-GIA35778