CAS 20644-12-6
:p-Carborane
Description:
p-Carborane, with the CAS number 20644-12-6, is a polyhedral boron cluster compound characterized by its unique structure and properties. It consists of a cage-like arrangement of boron and carbon atoms, specifically featuring a boron atom at each vertex of a polyhedron and carbon atoms positioned at specific sites within the structure. This compound is notable for its thermal stability, low volatility, and resistance to chemical degradation, making it useful in various applications, including materials science and nanotechnology. p-Carborane exhibits a high degree of symmetry and can be classified as a type of carborane, which are known for their ability to form stable, three-dimensional frameworks. Additionally, it has potential applications in the field of medicine, particularly in boron neutron capture therapy (BNCT) for cancer treatment, due to its ability to selectively target tumor cells. Its unique properties also make it a subject of interest in the development of advanced materials and as a potential building block for novel chemical compounds.
Formula:C2H12B10
InChI:InChI=1S/C2H12B10/c1-3-4(1)6(1)7(1)5(1,3)9(3)2-8(3,4,9)10(2,4,6)12(2,6,7)11(2,5,7)9/h1-12H
InChI key:InChIKey=UJEZTZCGCCTAFQ-UHFFFAOYSA-N
SMILES:[BH]1234[BH]567[BH]189[BH]2%10%11[BH]3%12%13[CH]45%14[BH]6%15%16[BH]78%17[CH]%109%18[BH]%12%11%19[BH]%13%14%15[BH]%16%17%19%18
Synonyms:- p-Carborane(12)
- p-Dicarbadodecaborane(12)
- 1,12-Dicarbadodecaborane(12)
- 1,12-Dicarba-closo-dodecaborane
- p-Carborane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1,12-DICARBADODECABORANE(12)
CAS:Formula:C2H12B10Purity:98%Color and Shape:SolidMolecular weight:144.2267p-Carborane
CAS:Controlled Productp-Carborane is a compound that has been used in the palladium-catalyzed coupling of nitrogen atoms. It has been shown to have magnetic resonance spectroscopy, steric interactions, and cross-coupling properties. p-Carborane is stable under mild conditions and can be used as an alternative to other functional assays. p-Carborane also has been shown to inhibit the growth of prostate cancer cells and human leukemia cells (HL60). The redox potentials for this compound are low energy, making it difficult for these compounds to react with other substances.
Formula:C2H12B10Purity:Min. 95%Color and Shape:PowderMolecular weight:144.23 g/mol

