CAS 206449-94-7

2-[(2-Furanylmethyl)sulfinyl]-N-[(2E)-4-[[4-(1-piperidinylmethyl)-2-pyridinyl]oxy]-2-buten-1-yl]acetamide

Description:

The chemical substance known as 2-[(2-Furanylmethyl)sulfinyl]-N-[(2E)-4-[[4-(1-piperidinylmethyl)-2-pyridinyl]oxy]-2-buten-1-yl]acetamide, with the CAS number 206449-94-7, exhibits several notable characteristics. It is a complex organic compound featuring a furan ring, a sulfinyl group, and a piperidine moiety, which contribute to its unique chemical properties. The presence of the sulfinyl group suggests potential reactivity and the ability to participate in various chemical reactions, such as oxidation or nucleophilic substitution. The compound's structure indicates it may possess biological activity, potentially acting as a pharmaceutical agent or a lead compound in drug development. Its molecular architecture, including the presence of multiple functional groups, suggests it may exhibit diverse interactions with biological targets. Additionally, the compound's solubility, stability, and reactivity would depend on the specific conditions, such as pH and temperature, making it essential to evaluate these factors in practical applications. Overall, this compound represents a significant area of interest in medicinal chemistry and related fields.

Formula: C₂₂H₂₉N₃O₄S

InChI: InChI=1/C22H29N3O4S/c26-21(18-30(27)17-20-7-6-14-28-20)23-9-2-5-13-29-22-15-19(8-10-24-22)16-25-11-3-1-4-12-25/h2,5-8,10,14-15H,1,3-4,9,11-13,16-18H2,(H,23,26)/b5-2+

InChI key: InChIKey=KMZQAVXSMUKBPD-GORDUTHDNA-N

SMILES: C(C=1C=C(OC/C=C/CNC(CS(CC2=CC=CO2)=O)=O)N=CC1)N3CCCCC3

Synonyms:

• Acetamide, 2-[(2-furanylmethyl)sulfinyl]-N-[(2E)-4-[[4-(1-piperidinylmethyl)-2-pyridinyl]oxy]-2-buten-1-yl]-
• Acetamide, 2-[(2-furanylmethyl)sulfinyl]-N-[4-[[4-(1-piperidinylmethyl)-2-pyridinyl]oxy]-2-butenyl]-, (E)-
• 2-[(2-Furanylmethyl)sulfinyl]-N-[(2E)-4-[[4-(1-piperidinylmethyl)-2-pyridinyl]oxy]-2-buten-1-yl]acetamide
• Acetamide, 2-[(2-furanylmethyl)sulfinyl]-N-[(2E)-4-[[4-(1-piperidinylmethyl)-2-pyridinyl]oxy]-2-butenyl]-

trans-Lafutidine

CAS: 206449-94-7

Formula: C₂₂H₂₉N₃O₄S

Color and Shape: White To Off-White Solid

Molecular weight: 431.55

Ref: 4Z-L-478

rac trans-Lafutidine

Controlled Product

CAS: 206449-94-7

Formula: C₂₂H₂₉N₃O₄S

Color and Shape: Neat

Molecular weight: 431.548

Ref: TR-L168505

Lafutidine (E)-Isomer

CAS: 206449-94-7

Formula: C₂₂H₂₉N₃O₄S

Molecular weight: 431.55

Ref: ST-EA-CP-L74011