CAS 2065-66-9
:Phosphonium, methyltriphenyl-, iodide (1:1)
Description:
Methyltriphenylphosphonium iodide, with the CAS number 2065-66-9, is a quaternary ammonium salt characterized by its phosphonium cation and iodide anion. It features a central phosphorus atom bonded to three phenyl groups and one methyl group, resulting in a bulky and lipophilic structure. This compound is typically a white to light yellow crystalline solid, soluble in polar organic solvents such as acetone and ethanol, but less soluble in non-polar solvents. Methyltriphenylphosphonium iodide is known for its role as a phase transfer catalyst and is often utilized in organic synthesis, particularly in reactions involving nucleophilic substitutions. Its stability under various conditions makes it a valuable reagent in synthetic chemistry. Additionally, the iodide ion contributes to its reactivity, allowing for the formation of various derivatives through substitution reactions. Overall, this compound is significant in both academic research and industrial applications due to its unique properties and versatility in facilitating chemical transformations.
Formula:C19H18P·I
InChI:InChI=1S/C19H18P.HI/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;/h2-16H,1H3;1H/q+1;/p-1
InChI key:InChIKey=JNMIXMFEVJHFNY-UHFFFAOYSA-M
SMILES:[P+](C)(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[I-]
Synonyms:- Iodomethane,Triphenylphosphonium
- Methyl Triphenyl Phosphonium Iodide
- Methyl Triphenylphosphonium Iodide
- Phosphonium, methyltriphenyl-, iodide
- Phosphonium, methyltriphenyl-, iodide (1:1)
- Triphenylmethylphosphinium iodide
- Triphenylmethylphosphonium iodide
- Methyltriphenylphosphonium iodide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Methyltriphenylphosphonium Iodide
CAS:Formula:C19H18IPPurity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:404.23Methyltriphenylphosphonium iodide, 98%
CAS:Methyltriphenylphosphonium iodide is as a reactant for synthesis of triphenylamine-based dyes and polyolefinic aromatic molecules with pyrene for use in dye-sensitized solar cells. Used as ligand in coupling reaction. It is also used as a precursor to a Wittig reagent. This Thermo Scientific ChemiFormula:C19H18IPPurity:98%Color and Shape:Crystals or powder or crystalline powder, WhiteMolecular weight:404.23Methyltriphenylphosphonium Iodide
CAS:Formula:C19H18IPPurity:97%Color and Shape:SolidMolecular weight:404.2245Methyl(trisphenyl)phosphonium iodide
CAS:Methyl(trisphenyl)phosphonium iodideFormula:C19H18P·IPurity:95%Color and Shape: white solidMolecular weight:404.22g/molMethyltriphenylphosphonium iodide
CAS:Formula:CH3P(C6H5)3IPurity:≥ 97.0%Color and Shape:White to off-white powderMolecular weight:404.23Methyltriphenylphosphonium iodide
CAS:Formula:C19H18IPPurity:98%Color and Shape:Solid, Crystalline Powder or PowderMolecular weight:404.231(Methyl)triphenylphosphonium Iodide
CAS:Controlled ProductApplications (Methyl)triphenylphosphonium Iodide is the precursor to a wittig reagent.
Formula:C19H18IPColor and Shape:NeatMolecular weight:404.22






