CAS 20651-67-6
:1-(4'-Iodophenyl)butane
Description:
1-(4'-Iodophenyl)butane, with the CAS number 20651-67-6, is an organic compound characterized by its structure, which features a butane chain attached to a phenyl group that is substituted with an iodine atom at the para position. This compound typically exhibits a hydrophobic nature due to its long hydrocarbon chain, making it less soluble in water but more soluble in organic solvents. The presence of the iodine atom introduces unique properties, such as increased molecular weight and potential for reactivity in nucleophilic substitution reactions. Additionally, the compound may exhibit interesting electronic properties due to the electron-withdrawing nature of the iodine atom, which can influence its reactivity and interaction with other chemical species. Its applications may span across various fields, including organic synthesis and medicinal chemistry, where it could serve as an intermediate or a building block for more complex molecules. Safety data should be consulted for handling and storage, as iodine-containing compounds can pose health risks.
Formula:C10H13I
InChI:InChI=1/C10H13I/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8H,2-4H2,1H3
SMILES:CCCCc1ccc(cc1)I
Synonyms:- 1-n-Butyl-4-iodobenzene
- +4-n-Butyliodobenzene
- 4-Iodo-n-butylbenzene
- 1-Butyl-4-Iodobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-n-Butyl-4-iodobenzene, 98%
CAS:<p>It is used as an active pharmaceutical intermediate. It is also used in the synthesis and characterization of photoelectronic polymers containing triphenylamine moiety and in the palladium-catalyzed conversion of aryl and vinyl triflates to bromides and chlorides. This Thermo Scientific Chemicals br</p>Formula:C10H13IPurity:98%Color and Shape:Clear colorless to yellow, LiquidMolecular weight:260.12Benzene, 1-butyl-4-iodo-
CAS:Formula:C10H13IPurity:95%Color and Shape:LiquidMolecular weight:260.1147
