CAS 20651-72-3

3-butylbenzoic acid

Description:

3-Butylbenzoic acid, with the CAS number 20651-72-3, is an aromatic carboxylic acid characterized by a benzoic acid core substituted with a butyl group at the meta position. This compound typically appears as a white to off-white solid and is soluble in organic solvents, while exhibiting limited solubility in water due to its hydrophobic butyl chain. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. 3-Butylbenzoic acid can be used in the synthesis of various organic compounds and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, and other specialty chemicals. Its physical properties, such as melting point and boiling point, can vary based on purity and specific conditions. As with many aromatic compounds, it may also exhibit distinct UV-Vis absorption characteristics, making it useful in analytical applications. Safety data should be consulted for handling and storage, as it may pose health risks if ingested or inhaled.

Formula: C₁₁H₁₄O₂

InChI: InChI=1/C11H14O2/c1-2-3-5-9-6-4-7-10(8-9)11(12)13/h4,6-8H,2-3,5H2,1H3,(H,12,13)

SMILES: CCCCc1cccc(c1)C(=O)O

Benzoic acid, 3-butyl-

CAS: 20651-72-3

Formula: C₁₁H₁₄O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 178.2277

Ref: IN-DA002IJ3

3-Butylbenzoic acid

CAS: 20651-72-3

3-Butylbenzoic acid

Purity: 95%

Molecular weight: 178.23g/mol

Ref: 54-OR1070431

3-n-Butylbenzoic acid

CAS: 20651-72-3

Formula: C₁₁H₁₄O₂

Purity: 95%

Color and Shape: No data available.

Molecular weight: 178.231

Ref: 10-F070790

3-N-Butylbenzoic acid

CAS: 20651-72-3

Versatile small molecule scaffold

Formula: C₁₁H₁₄O₂

Purity: Min. 95%

Molecular weight: 178.23 g/mol

Ref: 3D-VAA65172