CymitQuimica logo

CAS 206559-40-2

:

5-bromo-2-chloro-1,3-dimethylbenzene

Description:
5-Bromo-2-chloro-1,3-dimethylbenzene, also known by its CAS number 206559-40-2, is an aromatic compound characterized by the presence of both bromine and chlorine substituents on a dimethylbenzene framework. This compound features a benzene ring with two methyl groups located at the 1 and 3 positions, a bromine atom at the 5 position, and a chlorine atom at the 2 position. The presence of these halogen substituents can significantly influence the compound's reactivity, polarity, and solubility. Generally, halogenated aromatic compounds exhibit unique properties such as increased stability and potential for electrophilic substitution reactions. The compound may be used in various applications, including organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Its physical properties, such as boiling point and melting point, are influenced by the steric and electronic effects of the substituents. Safety data should be consulted for handling and disposal, as halogenated compounds can pose environmental and health risks.
Formula:C8H8BrCl
InChI:InChI=1/C8H8BrCl/c1-5-3-7(9)4-6(2)8(5)10/h3-4H,1-2H3
InChI key:PKTXUGAXFJNLQR-UHFFFAOYSA-N
SMILES:Cc1cc(cc(C)c1Cl)Br
Synonyms:
  • Benzene, 5-bromo-2-chloro-1,3-dimethyl-
  • 5-Bromo-2-chloro-1,3-dimethylbenzene
Found 4 products.