CymitQuimica logo

CAS 206559-43-5

:

5-Bromo-2-iodo-1,3-dimethylbenzene

Description:
5-Bromo-2-iodo-1,3-dimethylbenzene, with the CAS number 206559-43-5, is an aromatic compound characterized by the presence of both bromine and iodine substituents on a dimethylbenzene framework. This compound features a benzene ring with two methyl groups located at the 1 and 3 positions, while bromine and iodine are attached at the 5 and 2 positions, respectively. The presence of these halogen atoms contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. The molecular structure imparts specific physical properties, such as a relatively high boiling point and moderate solubility in organic solvents. Additionally, the compound may exhibit interesting electronic properties due to the electron-withdrawing nature of the halogens, which can influence its behavior in chemical reactions and interactions with other molecules. Overall, 5-Bromo-2-iodo-1,3-dimethylbenzene is a valuable compound in synthetic organic chemistry and materials science.
Formula:C8H8BrI
InChI:InChI=1S/C8H8BrI/c1-5-3-7(9)4-6(2)8(5)10/h3-4H,1-2H3
InChI key:InChIKey=BSIRLLZFIVAHES-UHFFFAOYSA-N
SMILES:IC1=C(C)C=C(Br)C=C1C
Synonyms:
  • 1-Bromo-3,5-dimethyl-4-iodobenzene
  • 4-Bromo-2,6-dimethyl-1-iodobenzene
  • 4-Bromo-2,6-dimethyliodobenzene
  • 5-Brom-2-iod-1,3-dimethylbenzol
  • 5-Bromo-2-iodo-m-xylene
  • Benzene, 5-bromo-2-iodo-1,3-dimethyl-
  • 5-Bromo-2-iodo-1,3-dimethylbenzene
Found 3 products.