CAS 206559-54-8
:1-decyl-4-isothiocyanatobenzene
Description:
1-Decyl-4-isothiocyanatobenzene is an organic compound characterized by its isothiocyanate functional group attached to a benzene ring, which is further substituted with a decyl chain. This compound typically exhibits a hydrophobic nature due to the long alkyl chain, making it less soluble in water but more soluble in organic solvents. The isothiocyanate group is known for its reactivity, particularly in nucleophilic addition reactions, and can serve as a versatile building block in organic synthesis. Additionally, compounds containing isothiocyanate groups are often studied for their biological activities, including potential anticancer properties and effects on cellular signaling pathways. The presence of the decyl group contributes to the compound's lipophilicity, which may influence its interaction with biological membranes. Overall, 1-decyl-4-isothiocyanatobenzene is of interest in both synthetic organic chemistry and medicinal chemistry due to its unique structural features and potential applications.
Formula:C17H25NS
InChI:InChI=1/C17H25NS/c1-2-3-4-5-6-7-8-9-10-16-11-13-17(14-12-16)18-15-19/h11-14H,2-10H2,1H3
SMILES:CCCCCCCCCCc1ccc(cc1)N=C=S
Synonyms:- Benzene, 1-decyl-4-isothiocyanato-
- 1-Decyl-4-isothiocyanatobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
